a, abbr, acronym, address, applet, article, aside, audio, b, blockquote, big, body, center, canvas, caption, cite, code, command, datalist, dd, del, details, dfn, dl, div, dt, 
em, embed, fieldset, figcaption, figure, font, footer, form, h1, h2, h3, h4, h5, h6, header, hgroup, html, i, iframe, img, ins, kbd, keygen, label, legend, li, 
meter, nav, object, ol, output, p, pre, progress, q, s, samp, section, small, span, source, strike, strong, sub, sup, table, tbody, tfoot, thead, th, tr, td, video, tt,
u, ul, var {
    border: 0 none;
    font-size: 100%;
    margin: 0;
    padding: 0;
    border: 0;
    outline: 0;
    vertical-align: top;
}
ol,
ul,
li {
	list-style-type: none;
	list-style: none;
	margin: 0;
	padding: 0;	
}
blockquote,
q {
	quotes: none;
}
table,
table td {
	padding: 0;
	border: none;
	border-collapse: collapse;
}
embed { 
	vertical-align: top;
}
.video embed,
.video object,
.video iframe {
	width: 100%;
    height: auto;
}
.clearfix:before,
.clearfix:after {
    content: '';
    display: table;
}
.clearfix:after {
    clear: both;
}
.clear {
    clear: both;
    display: block;
    overflow: hidden;
    visibility: hidden;
    width: 0;
    height: 0;
}
article,
aside,
details,
figcaption,
main,
figure,
footer,
header,
hgroup,
nav,
section,
summary {
    display: block;
}
textarea {
    overflow: auto;
    vertical-align: top;
}
:focus,
:active,
:hover {
    outline: none;
}
* {
	padding: 0;
	margin: 0;
}
*, *:before, *:after {
    -webkit-box-sizing: border-box;
    -moz-box-sizing: border-box;
    box-sizing: border-box;
}
html,
body {
	min-width: 320px;
	font-family: "MontserratRegular", sans-serif;
	color: #000;
	font-size: 16px;
	line-height: 1;
	font-weight: 400;
	background: #f6f6f6;
}
body {
	overflow-x: hidden;
}
a {
	color: #000;
	text-decoration: none;
	-webkit-transition: all 0.4s ease 0s;
	-o-transition: all 0.4s ease 0s;
	transition: all 0.4s ease 0s;
}
img {
	max-width: 100%;
	height: auto;
}
input,
textarea,
select,
button {
	font-family: "MontserratRegular", sans-serif;
}
textarea {
	resize: vertical;
}


body {
	--main-color: #169FFB;
}
body.b2c {
	--main-color: #169FFB;
}
body.b2b {
	--main-color: #045B94;
}
body.chp {
	--main-color: #EAA134;
}


/*----------------------------------------------------------------
Fonts
----------------------------------------------------------------*/

@font-face {
    font-family: 'ComfortaaRegular';
    src: url('../fonts/Comfortaa-Regular.woff2') format('woff2');
    font-weight: normal;
    font-style: normal;
    font-display: swap;
}
@font-face {
    font-family: 'ComfortaaBold';
    src: url('../fonts/Comfortaa-Bold.woff2') format('woff2');
    font-weight: bold;
    font-style: normal;
    font-display: swap;
}
@font-face {
    font-family: 'MontserratRegular';
    src: url('../fonts/Montserrat-Regular.woff2') format('woff2');
    font-weight: normal;
    font-style: normal;
    font-display: swap;
}
@font-face {
    font-family: 'MontserratLight';
    src: url('../fonts/Montserrat-Light.woff2') format('woff2');
    font-weight: 300;
    font-style: normal;
    font-display: swap;
}
@font-face {
	font-family: 'MontserratItalic';
	src: url('../fonts/Montserrat-Italic.woff2') format('woff2');
	font-weight: normal;
	font-style: italic;
	font-display: swap;
}
@font-face {
    font-family: 'MontserratMedium';
    src: url('../fonts/Montserrat-Medium.woff2') format('woff2');
    font-weight: 500;
    font-style: normal;
    font-display: swap;
}
@font-face {
    font-family: 'MontserratSemiBold';
    src: url('../fonts/Montserrat-SemiBold.woff2') format('woff2');
    font-weight: 600;
    font-style: normal;
    font-display: swap;
}
@font-face {
    font-family: 'MontserratBold';
    src: url('../fonts/Montserrat-Bold.woff2') format('woff2');
    font-weight: bold;
    font-style: normal;
    font-display: swap;
}


/*----------------------------------------------------------------
Wrapper
----------------------------------------------------------------*/

.layout {
	padding: 120px 0 0;
	overflow-x: hidden;
}
.wrapper {
	margin: 0 auto;
	width: 100%;
	max-width: 1440px;
	padding: 0 15px;
}
.s-head {
	position: relative;
	margin: 0 0 40px;
}
.s-head--center {
	text-align: center;
}
.s-head__title {
	position: relative;
	padding: 0 0 20px 0;
	font-family: 'ComfortaaBold', sans-serif;
	color: #000;
	font-size: 36px;
	line-height: 40px;
	font-weight: 400;
}
.s-head__title:before {
	position: absolute;
	left: 0;
	bottom: 0;
	right: 0;
	margin: auto;
	content: '';
	width: 80px;
	height: 6px;
	border-radius: 5px;
	background: var(--main-color);;
}
.s-head__description {
	margin: 15px 0 0;
	color: #000;
	font-size: 18px;
	line-height: 22px;
}


/*----------------------------------------------------------------
Header
----------------------------------------------------------------*/

.header {
	position: fixed;
	left: 0;
	top: 0;
	width: 100%;
	z-index: 99;
}
.header__inner {
	position: relative;
	display: flex;
	justify-content: space-between;
	align-items: center;
}
.header-top,
.header-bottom {
	display: flex;
	flex-direction: column;
	justify-content: center;
}
.header-top {
	position: relative;
	z-index: 2;
	height: 70px;
	background: #fff;
}
.header--scrolled .header-top {
	box-shadow: 6px 6px 12px rgba(0, 0, 0, 0.1);
}
.header-bottom {
	height: 50px;
	background: #40B0FC;
}
.header__logo {
	display: flex;
	flex: 0 0 148px;
	max-width: 148px;
}
.header__yawidget {
	border-radius: 5px;
	overflow: hidden;
}
.header__orderstime,
.header__worktime {
	font-size: 14px;
}
.header__orderstime {
	flex: 0 0 160px;
	max-width: 160px;
}
.header__worktime {
	position: relative;
	padding: 0 0 0 20px;
}
.online-indicator {
	position: absolute;
	left: 0;
	top: 0;
	bottom: 0;
	margin: auto;
	width: 11px;
	height: 11px;
	background-color: #0fcc45;
	border-radius: 50%;
}
.online-indicator:before {
	position: absolute;
	content: '';
	display: block;
	width: 11px;
	height: 11px;
	background-color: #0fcc45;
	opacity: 0.7;
	border-radius: 50%;	
	animation: blink 1.5s ease-in infinite;
}
@keyframes blink {
	from {
		transform: scale(0.5);
		opacity: 1;
	}
	to {
		transform: scale(2);
		opacity: 0;
	}
}
.header-telbox__title {
	color: #000;
	font-size: 14px;
}
.header-telbox__number {
	color: #000;
	font-size: 16px;
}
.header-telbox__title {
	margin: 0 0 5px;
}
.header-telbox__number {
	font-family: "MontserratBold", sans-serif;
}
.header-telbox__number:hover {
	color: #002E74;
}
.header-search {
	position: relative;
	margin: 0 0 0 30px;
	flex: 0 0 250px;
	max-width: 250px;
}
.header-search__ico {
	width: 100%;
	height: 40px;
	display: flex;
	display: none;
	align-items: center;
	justify-content: center;
	background-color: #fff;
	border: 1px solid #ccc;
	background-image: url(../images/i/i-search.svg);
	background-position: center;
	background-repeat: no-repeat;
	background-size: 20px;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.header-search__ico:hover {
	opacity: 0.8;
}
.header-search--active .header-search__ico {
	background-image: url(../images/i/i-close.svg);
	background-size: 20px;
}
.header-search-box {
	position: relative;
	height: 40px;
	width: 100%;
	padding: 5px 30px 5px 10px;
	border-radius: 5px;
	border: 1px solid #ccc;
	background: #fff;
	transition: all 0.4s ease 0s;
}
.header-search--active .header-search-box {
	opacity: 1;
	visibility: visible;
	z-index: 2;
}
.header-search-form__input {
	height: 30px;
	width: 100%;
	background-color: #fff;
	border-radius: 3px;
	border: none;
	font-size: 16px;
	line-height: 30px;
}
.header-search-form__submit {
	position: absolute;
	right: 0;
	top: 0;
	bottom: 0;
	margin: auto;
    border: none;
	background-color: transparent;
	background-image: url(../images/i/i-search.svg);
	background-position: center;
	background-repeat: no-repeat;
	background-size: 20px;
	width: 35px;
	height: 40px;
	cursor: pointer;
	transition: all 0.4s ease 0s;
    cursor: pointer;
    transition: all 0.4s ease 0s;	
}
.header-search-form__submit:hover {
	opacity: 0.8;
}
.header-bottom {
	transition: all 0.4s ease 0s;
}
.compensate-for-scrollbar .header-bottom,
.header-bottom--out {
	transform: translateY(-100%);
}
.header-bottom__inner {
	display: flex;
	align-items: center;
	justify-content: space-between;
}
.header-nav {
	flex-grow: 1;
}
.header-nav > ul {
	display: flex;
	align-items: center;
	justify-content: center;
}
.header-nav > ul > li,
.header-nav a {
	font-size: 16px;
}
.header-nav > ul > li {
	/* position: relative; */
	margin: 0 15px;
}
.header-nav > ul > li:last-child {
	/* margin: 0; */
}
.header-nav > ul > li > a {
	position: relative;
	display: block;
	padding: 17px 0;
	font-family: "MontserratSemiBold", sans-serif;
	color: #fff;
}
.header-nav > ul > li > a:hover {
	color: #002E74;
}
.header-nav > ul > li.menu-item-has-children > a {
	padding: 17px 14px 17px 0;
}
.header-nav > ul > li.menu-item-has-children > a:after {
	position: absolute;
	right: 0;
	top: 0;
	bottom: 4px;
	content: '';
	width: 7px;
	height: 7px;
	border-left: 1px solid #fff;
	border-top: 1px solid #fff;
	transform: rotate(225deg);
	margin: auto;
	transition: all 0.4s ease 0s;
}
.header-nav > ul > li.menu-item-23 a {
	position: relative;
}
.header-nav > ul > li.menu-item-23 a:before {
	position: absolute;
	right: -10px;
	top: 10px;
	content: attr(data-actions);
	width: 14px;
	height: 14px;
	font-size: 10px;
	line-height: 14px;
	color: #fff;
	text-align: center;
	border-radius: 50%;
	background: red;
}
.header-nav > ul > li > .sub-menu {
	position: absolute;
	top: 100%;
	left: 0;
	box-shadow: -1px 4px 21px rgb(0 0 0 / 10%);
	padding: 25px 0;
	border-radius: 10px;
	width: 100%;
	background: #fff;
	z-index: 0;
	opacity: 0;
	transform: translateY(10px);
	visibility: hidden;
	transition: all 0.4s ease 0s;
	display: flex;
	flex-wrap: wrap;
}
.header-nav > ul > li > .sub-menu > li {
	margin: 5px 0;
	padding: 0 25px;
	border-right: 1px solid #535353;
	flex: 0 0 25%;
	max-width: 25%;
}
.header-nav > ul > li > .sub-menu > li:last-child {
	border: none;
}
.header-nav > ul > li > .sub-menu > li.menu-item-has-children > a {
	font-family: 'ComfortaaBold', sans-serif;
	font-size: 16px;
}
.header-nav > ul > li > .sub-menu > li.menu-item-has-children > ul {
	margin: 15px 0 0;
}
.header-nav > ul > li > .sub-menu > li.menu-item-has-children > ul > li {
	margin: 0 0 7px;
}
.header-nav > ul > li > .sub-menu > li.menu-item-has-children > ul > li:last-child {
	margin: 0;
}
.header-nav > ul > li > .sub-menu > li.menu-item-has-children > ul > li > a {
	font-size: 14px;
}
.header-nav .sub-menu li > a {
	color: #535353;
}
.header-nav .sub-menu li > a:hover {
	color: #002E74;
}
.header-nav > ul > li.menu-item-has-children:hover,
.header-nav > ul > li.menu-item-has-children:hover > a {
	color: #002E74;
}
.header-nav > ul > li.menu-item-has-children:hover > a:after {
	border-color: #002E74;
}
.header-nav > ul > li:hover > .sub-menu {
	transform: translateY(0);
	z-index: 3;
	opacity: 1;
	visibility: visible;
}
.header-tel__callback {
	margin: 0 0 0 10px;
	background: #FD7701;
	padding: 10px 20px;
	border: none;	
	border-radius: 5px;
	font-family: "MontserratBold", sans-serif;
	color: #fff;
    font-size: 16px;
	line-height: 1;
    cursor: pointer;
	transition: all 0.4s ease 0s;
}
.header-tel__callback:hover {
	background-color: #002E74;
}
.header-tel__callback:first-child {
	margin: 0;
}
.soc-nav ul {
	display: flex;
	align-items: center;
}
.header .soc-nav__item {
	margin: 0 5px;
}
.soc-nav__link {
	display: block;
	width: 32px;
	height: 32px;
	background-size: 32px;
}
.header .soc-nav__link {
	/* width: 24px;
	height: 24px;
	background-size: 24px; */
}
.soc-nav__link:hover {
	opacity: 0.7;
}
.soc-nav__link--wa {
	background: url(../images/i/i-whatsapp.svg) no-repeat;
	background-size: 32px;
}
.soc-nav__link--tg {
	background: url(../images/i/i-tg.svg) no-repeat;
	background-size: 32px;
}
.soc-nav__link--vk {
	background: url(../images/i/i-vk.svg) no-repeat;
	background-size: 32px;
}


/*----------------------------------------------------------------
Adaptive menu gamburger
----------------------------------------------------------------*/

.menu-toggle-btn {
	display: none;
	align-items: center;
	border: none;
	background-color: transparent;
	cursor: pointer;
}
.adaptive-menu-toggle {
	display: block;
	position: relative;
	width: 30px;
	height: 24px;
	background: #ecc252;
	border: none;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.header__hamburger {
	margin: 0 20px 0 0;
	display: none;
}
.menu-toggle-btn__lines {
	position: relative;
	width: 28px;
	height: 20px;
}
.menu-toggle-line {
	position: absolute;
	background: #000;
	display: block;
	margin: auto;
	height: 4px;
	width: 100%;
	border-radius: 3px;
}
.menu-toggle-line--1 {
	top: 0;
	-webkit-transition: width 0.2s ease 0.4s;
	-o-transition: width 0.2s ease 0.4s;
	transition: width 0.2s ease 0.4s;
}
.menu-toggle-line--2 {
	top: 0;
	bottom: 0;
	margin: auto;
	-webkit-transition: width 0.2s ease 0.3s;
	-o-transition: width 0.2s ease 0.3s;
	transition: width 0.2s ease 0.3s;
}
.menu-toggle-line--3 {
	bottom: 0;
	-webkit-transition: width 0.2s ease 0.2s;
	-o-transition: width 0.2s ease 0.2s;
	transition: width 0.2s ease 0.2s;
}
.menu-toggle-line--4,
.menu-toggle-line--5 {
	opacity: 0;
	top: 9px;
}
.menu-toggle-line--4 {
	-webkit-transition: opacity 0.2s ease 0.2s, -webkit-transform 0.2s ease 0.2s;
	transition: opacity 0.2s ease 0.2s, -webkit-transform 0.2s ease 0.2s;
	-o-transition: opacity 0.2s ease 0.2s, -o-transform 0.2s ease 0.2s;
	-moz-transition: opacity 0.2s ease 0.2s, transform 0.2s ease 0.2s, -moz-transform 0.2s ease 0.2s;
}
.menu-toggle-line--5 {
	-webkit-transition: opacity 0.2s ease 0s, -webkit-transform 0.2s ease 0s;
	transition: opacity 0.2s ease 0s, -webkit-transform 0.2s ease 0s;
	-o-transition: opacity 0.2s ease 0s, -o-transform 0.2s ease 0s;
	-moz-transition: opacity 0.2s ease 0s, transform 0.2s ease 0s, -moz-transform 0.2s ease 0s;
}
.menu-toggle-btn--open .menu-toggle-line--1 {
	width: 0;
	-webkit-transition: width 0.2s ease 0s;
	-o-transition: width 0.2s ease 0s;
	transition: width 0.2s ease 0s;
}
.menu-toggle-btn--open .menu-toggle-line--2 {
	width: 0;
	-webkit-transition: width 0.2s ease 0.1s;
	-o-transition: width 0.2s ease 0.1s;
	transition: width 0.2s ease 0.1s;
}
.menu-toggle-btn--open .menu-toggle-line--3 {
	width: 0;
	-webkit-transition: width 0.2s ease 0.2s;
	-o-transition: width 0.2s ease 0.2s;
	transition: width 0.2s ease 0.2s;
}
.menu-toggle-btn--open .menu-toggle-line--4 {
	opacity: 1;
	-webkit-transform: rotate(45deg) translateZ(0);
	-ms-transform: rotate(45deg) translateZ(0);
	-o-transform: rotate(45deg) translateZ(0);
	transform: rotate(45deg) translateZ(0);
	-webkit-transition: opacity 0.2s ease 0.2s, -webkit-transform 0.2s ease 0.2s;
	transition: opacity 0.2s ease 0.2s, -webkit-transform 0.2s ease 0.2s;
	-o-transition: opacity 0.2s ease 0.2s, -o-transform 0.2s ease 0.2s;
	-moz-transition: opacity 0.2s ease 0.2s, transform 0.2s ease 0.2s, -moz-transform 0.2s ease 0.2s;
}
.menu-toggle-btn--open .menu-toggle-line--5 {
	opacity: 1;
	-webkit-transform: rotate(-45deg) translateZ(0);
	-ms-transform: rotate(-45deg) translateZ(0);
	-o-transform: rotate(-45deg) translateZ(0);
	transform: rotate(-45deg) translateZ(0);
	-webkit-transition: opacity 0.2s ease 0.4s, -webkit-transform 0.2s ease 0.4s;
	transition: opacity 0.2s ease 0.4s, -webkit-transform 0.2s ease 0.4s;
	-o-transition: opacity 0.2s ease 0.4s, -o-transform 0.2s ease 0.4s;
	-moz-transition: opacity 0.2s ease 0.4s, transform 0.2s ease 0.4s, -moz-transform 0.2s ease 0.4s;
}
.menu-toggle-btn__text {
	margin: 0 0 0 20px;
}


/*----------------------------------------------------------------
Adaptive slide
----------------------------------------------------------------*/

.s-adaptive-slide {
    position: fixed;
    padding: 30px 15px;
    width: 100%;
	top: 70px;
    height: calc(100% - 70px);
    overflow-y: auto;
    z-index: 999;
    background: #323030;
    -webkit-overflow-scrolling: touch;
    transition: all 0.3s ease 0s;
    backface-visibility: hidden;
    transform: translateX(-100%);
}
.s-adaptive-slide--open {
    transform: translateX(0);
}
.adaptive-nav li {
	margin: 0 0 20px;
}
.adaptive-nav li:last-child {
	margin: 0;
}
.adaptive-nav li,
.adaptive-nav a {
	font-family: 'MontserratMedium', sans-serif;
	font-size: 20px;
	color: #fff;
}
.adaptive-nav a:hover {
	color: #FDB027;
}
.adaptive-soc,
.adaptive-tel {
	margin: 30px 0 0;
}
.adaptive-soc li {
	margin: 0 10px 0 0;
}
.adaptive-soc li:last-child {
	margin: 0;
}
.adaptive-tel__number {
	font-family: "MontserratBold", sans-serif;
	color: #fff;
    font-size: 22px;
    font-weight: 700;
}
.adaptive-tel__number:hover {
	color: #FDB027;
}


/*----------------------------------------------------------------
Hero
----------------------------------------------------------------*/

.hero {
	position: relative;
	background-color: #f6f6f6;
	height: 650px;
	overflow: hidden;
}
.hero__bg {
	position: absolute;
	width: 100%;
	height: 100%;
	left: 0;
	top: 0;
	background-position: right center;
	background-size: cover;
	background-repeat: no-repeat;
}
.hero__inner {
	position: relative;
	height: 650px;
	display: flex;
	flex-direction: column;
	justify-content: center;
}
.hero__container {
	margin: -100px 0 0;
}
.hero__content {
	position: relative;
	z-index: 1;
	max-width: 650px;
}
.hero__title {
	margin: 0 0 25px;
	font-family: 'ComfortaaBold', sans-serif;
	color: #1c1c1c;
	font-size: 55px;
	line-height: 1.15;
	font-weight: 400;
}
.hero__title span {
	color: var(--main-color);
}
.hero__description {
	margin: 25px 0 0;
	color: #1c1c1c;
	font-weight: 400;
}
.hero__description,
.hero__description p {
	font-size: 20px;
	line-height: 1.4;
}
.hero__description p {
	margin: 0 0 10px;
}
.hero__description p:last-child {
	margin: 0;
}
.hero-buttons {
	margin: 60px 0 0;
	display: flex;
	align-items: center;
}
.hero-button {
	flex: 0 0 260px;
	max-width: 260px;
	line-height: 1;
	padding: 16px 5px;
	font-family: "MontserratBold", sans-serif;
	border: 1px solid #fff;
	font-size: 18px;
	text-align: center;
	transition: all 0.4s ease 0s;
	cursor: pointer;
}
.hero-button--transparent {
	background-color: transparent;
	color: #fff;
	border-radius: 10px 0 0 10px;
}
.hero-button--blue {
	background-color: var(--main-color);
	color: #fff;
	border-color: var(--main-color);
	border-radius: 10px 0 0 10px;
}
.hero-button--white {
	background-color: #fff;
	color: #000;
	border-color: var(--main-color);
	border-radius: 0 10px 10px 0;
}
.b2b .hero-button--blue,
.b2b .hero-button--white {
	border-radius: 10px;
}
.b2b .hero-button--white,
.b2b .hero-button--blue {
	margin: 0 10px 0 0;
}
.hero-button--blue:hover,
.hero-button--transparent:hover,
.hero-button--white:hover {
	background-color: #002E74;
	border-color: #002E74;
}
.hero-button--white:hover {
	color: #fff;
}
.hero-cta {
	margin: 30px 0 0;
}
.hero-ctaform {
	max-width: 600px;
}
.hero-ctaform__row {
	display: flex;
	margin: 0 -5px;
}
.hero-ctaform__col {
	flex: 0 0 30%;
	max-width: 30%;
	padding: 0 5px;
}
.hero-ctaform__col:last-child {
	flex: 0 0 40%;
	max-width: 40%;
}
.hero-ctaform__input,
.hero-ctaform__submit {
	width: 100%;
	height: 50px;
	border-radius: 5px;
	transition: all 0.4s ease 0s;
}
.hero-ctaform__input {
	padding: 0 10px;
	border: 1px solid #535353;
	background-color: #fff;
	color: #535353;
	font-size: 15px;
	line-height: 50px;
}
.hero-ctaform__input.error {
	border-color: red;
}
.hero-ctaform__submit {
	background: var(--main-color);
	border: none;
	padding: 5px;
	font-family: 'MontserratSemiBold', sans-serif;
	color: #fff;
	font-size: 15px;
	line-height: 1.1;
	cursor: pointer;
}
.hero-ctaform__submit:hover {
	opacity: 0.8;
}
.hero__img {
	position: absolute;
	right: 100px;
	top: 50px;
	margin: auto;
}
.hero__img img {
	border-radius: 50%;
}
.b2b .hero__img img {
	border-radius: 0;
}
.chp .hero__img {
	width: 500px;
	height: 500px;
}
.chp .hero__img img {
	border-radius: 50%;
	object-fit: cover;
	width: 100%;
	height: 100%;
}
.hero-action {
	position: absolute;
	padding: 0 30px;
	right: 45%;
	transform: translateX(50%);
	top: 20px;
	width: 235px;
	height: 235px;
	border-radius: 50%;
	background: var(--main-color);
	text-align: center;
	display: flex;
	flex-direction: column;
	justify-content: center;
	color: #002E74;
}
.hero-action__title {
	font-family: 'MontserratBold', sans-serif;
	color: #002E74;
	font-size: 15px;
	line-height: 1.15;
}
.b2b .hero-action__title,
.b2b .hero-action__bottomtext {
	color: #fff;
}
.hero-action__percent {
	margin: 10px 0 0;
	color: #fff;
	font-size: 60px;
	font-family: 'MontserratSemiBold', sans-serif;
}
.hero-action__bottomtext {
	margin: 10px 0 0;
	font-family: 'MontserratBold', sans-serif;
	color: #002E74;
	font-size: 15px;
	line-height: 1.15;
	text-transform: uppercase;
}
.hero-edges {
	position: relative;
	margin: -100px 0 0;
}
.hero-edges__row {
	display: flex;
	margin: 0 -15px;
	flex-wrap: wrap;
	align-items: center;
}
.hero-edges__col {
	flex: 0 0 25%;
	padding: 0 15px;
	margin: 15px 0 0;
}
.hero-edge {
	height: 160px;
	padding: 0 10px;
	background-color: #fff;
	box-shadow: 4px 4px 12px rgba(0, 0, 0, 0.2);
	border-radius: 30px;
	display: flex;
	align-items: center;
}
.hero-edge__ico {
	margin: 0 10px 0 0;
	flex: 0 0 55px;
	max-width: 55px;
	max-height: 55px;
}
.hero-edge__title {
	font-family: 'MontserratBold', sans-serif;
	color: #002E74;
	font-size: 17px;
	line-height: 20px;
}
.hero-edge__description {
	margin: 10px 0 0;
	/* color: #535353; */
	color: #002E74;
	font-size: 15px;
	line-height: 18px;
}


/*----------------------------------------------------------------
Services section
----------------------------------------------------------------*/

.s-services {
	position: relative;
	margin: 60px 0 30px;
}
.s-relservices {
	position: relative;
	margin: 30px 0;
}
.services-grid__row {
	margin: 0 -15px;
	display: flex;
	flex-wrap: wrap;
}
.services-grid__col {
	margin: 0 0 30px;
	padding: 0 15px;
	flex: 0 0 25%;
	max-width: 25%;
}
.b-service {
	border: 1px dashed;
	display: block;
	overflow: hidden;
	padding: 15px 15px 145px;
	position: relative;
	height: 100%;
	background: #fff;
    border-radius: 20px;
	transition: all 0.4s ease 0s;
}
.b-service:hover {
	background: rgba(0,175,242,0.1);
}
.b-service__ico {
	position: absolute;
	z-index: 1;
	right: -20px;
	bottom: 15px;
	max-width: 140px;
	max-height: 140px;
}
.b-service__ico img {
	height: 100%;
	width: 100%;
	object-fit: cover;
}
.b-service__title {
	margin: 0 0 25px;
	font-family: "ComfortaaBold", sans-serif;
	color: #000;
    font-size: 18px;
}
.b-service-list li {
	position: relative;
	margin: 0 0 10px;
	padding: 0 0 0 25px;
	color: #535353;
}
.b-service-list li:before {
	position: absolute;
	left: 0;
	top: 7px;
	content: '';
	width: 15px;
	height: 1px;
	background-color: var(--main-color);
}
.b-service-list li:last-child {
	margin: 0;
}
.b-service__more {
	position: absolute;
	z-index: 1;
	left: 15px;
	bottom: 15px;
	padding: 12px 20px;
	border: none;
	border-radius: 5px;
	background-color: var(--main-color);
	font-family: 'MontserratSemiBold', sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.relservices-slider {
	padding: 0 60px;
}
.relservices-slider .slick-list {
	margin: 0 -15px;
}
.relservices-slider .services-grid__col {
	margin: 0 15px;
	padding: 0;
	flex: 0 0 100%;
	max-width: none;
}
.relservices-slider .b-service {
	min-height: 330px;
}
.relservices-slider .slick-arrow {
	position: absolute;
	z-index: 1;
	top: 0;
	bottom: 0;
	margin: auto;
	width: 50px;
	height: 50px;
	box-shadow: 4px 6px 20px rgba(0,0,0,0.2);
	border: none;
	border-radius: 50%;
	background-color: #fff;
	background-position: center;
	background-repeat: no-repeat;
	background-size: 18px 20px;
	color: transparent;
	font-size: 0;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.relservices-slider .slick-prev {
	left: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
	transform: rotate(180deg);
}
.relservices-slider .slick-next {
	right: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
}
.relservices-slider .slick-arrow:hover {
	box-shadow: 4px 6px 20px rgba(0,0,0,0.4);
}



/*----------------------------------------------------------------
Services items section
----------------------------------------------------------------*/

.b-service-item {
	padding: 15px;
	border-radius: 5px;
	border: 1px solid #dde5eb;
	text-align: center;
}
.b-service-item__title {
	margin: 0 0 10px;
	font-family: 'ComfortaaBold', sans-serif;
	font-size: 18px;
	min-height: 40px;
}
.b-service-item__img {
	margin: 0 0 15px;
	max-height: 100px;
}
.b-service-item__img img {
	max-height: 100px;
}
.b-service-item__price {
	margin: 0 0 15px;
	font-family: 'MontserratSemiBold', sans-serif;
	font-size: 20px;
}
.b-service-item__order {
	margin: 15px 0 0;
}
.b-service-item__btn {
	padding: 12px 35px;
	border: none;
	border-radius: 5px;
	background-color: #18a0fb;
	font-family: 'MontserratSemiBold', sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.b-service-item__btn:hover {
	background-color: #002E74;
}


/*----------------------------------------------------------------
Includes section
----------------------------------------------------------------*/

.s-includes {
	margin: 30px 0 60px 0;
}
.s-includes .wrapper {
	max-width: 1320px;
}
.includes-tabs {
	margin: 0 0 25px;
	display: flex;
	align-items: center;
	justify-content: center;
}
.includes-tab {
	margin: 5px;
	padding: 12px 25px;
	border-radius: 5px;
	background: #fff;
	border: 2px solid var(--main-color);
	box-shadow: 4px 6px 20px rgba(0, 0, 0, 0.2);
	font-family: "MontserratRegular", sans-serif;
	font-size: 16px;
	line-height: 1;
	color: #535353;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.includes-tab--active {
	background-color: var(--main-color);
	box-shadow: none;
	color: #fff;
}
.b-includes-tabitem {
	display: none;
}
.b-includes-tabitem--active {
	display: block;
}
.b-includes-item-title {
	margin: 0 0 10px;
	width: 100%;
	border: none;
	background-color: transparent;
	display: flex;
	cursor: pointer;
	text-align: left;
	transition: all 0.4s ease 0s;
}
.b-includes-item-title__ico {
	margin: 0 10px 0 0;
	border: 1px dashed #a3a3a3;
	background-color: #fff;
	height: 60px;
	flex: 0 0 64px;
	max-width: 64px;
	border-radius: 15px;
	display: flex;
	flex-direction: column;
	align-items: center;
	justify-content: center;
}
.b-includes-item-title--active .b-includes-item-title__ico {
	border-color: var(--main-color);
}
.b-includes-item-title__text {
	flex: 1;
	border-radius: 10px 0 0 10px;
	padding: 5px 15px;
	min-height: 60px;
	border: none;
	display: flex;
	flex-direction: column;
	justify-content: center;
	box-shadow: 0px 5px 10px rgba(116, 116, 116, 0.2);
	background: #fff;
	font-family: 'ComfortaaBold', sans-serif;
	color: #535353;
	font-size: 16px;
}
.b-includes-item-title--active .b-includes-item-title__text {
	color: #fff;
	background-color: var(--main-color);
}
.b-includes-item-title:last-child {
	margin: 0;
}
.includes-container {
	display: flex;
}
.includes-container__aside {
	flex: 0 0 310px;
	max-width: 310px;
}
.includes-container__images {
	flex-grow: 1;
}
.b-includes-item-group,
.b-includes-item-img {
	display: none;
}
.b-includes-item-group--active,
.b-includes-item-img--active {
	display: block;
}
.b-includes-item-img img {
	border-radius: 0 10px 10px 0;
}
.b-includes-item__list {
	margin: 10px 0 0 10px;
}
.b-includes-item__list ul {
	display: flex;
	flex-wrap: wrap;
}
.b-includes-item__list li {
	position: relative;
	padding: 0 0 0 12px;
	margin: 5px 10px 5px 0;
	color: #535353;
}
.b-includes-item__list li:before {
	position: absolute;
	left: 0;
	top: 4px;
	content: '';
	background: var(--main-color);
	width: 8px;
	height: 8px;
	border-radius: 50%;
}


/*----------------------------------------------------------------
Table section
----------------------------------------------------------------*/

.s-table {
	margin: 60px 0;
}
.table-box table {
    width: 100%;
    border-collapse: collapse;
}
.table-box th, .table-box td {
    border: 1px solid #ccc;
    text-align: left;
}
.table-box th {
	padding: 15px;
	font-size: 18px;
}
.table-box td {
	padding: 10px 15px;
}
.table-box thead,
.table-box .table-header {
    font-family: 'MontserratSemiBold', sans-serif;
}
.table-box.dark .table-header,
.table-box.dark .table-header td {
	background-color: #002147;
	color: #fff;
}
.table-box.light .table-header {
	background-color: #fff;
	color: #535353;
}
.table-box.dark thead tr {
	background: #113050;
	color: #fff;
}
.table-box.light thead tr {
	background: #f5f7fa;
}
.table-box.dark tbody tr:not(.table-header):nth-child(even) {
	background-color: #F0F5F7;
}
.table-box.dark tbody tr:not(.table-header):nth-child(odd) {
	background-color: #fff;
}


/*----------------------------------------------------------------
Cases section
----------------------------------------------------------------*/

.s-cases {
	padding: 30px 0 60px;
}
.cases-slider {
	padding: 0 60px;
	-webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none;
    -webkit-touch-callout: none;
    -khtml-user-select: none;
    -ms-touch-action: pan-y;
    -webkit-tap-highlight-color: transparent;
}
.case-item {
	display: flex;
	align-items: flex-start;
}
.case-item--mb30 {
	margin: 0 0 30px 0;
}
.case-item--mb30:last-child {
	margin: 0;
}
.case-item__beforeafter {
	position: relative;
	/* flex: 0 0 600px; */
	width: 100%;
	max-width: 600px;
	aspect-ratio: 4 / 3;
	overflow: hidden;
	border-radius: 20px;
}
.case-item__before {
	position: absolute;
	left: 0;
	top: 0;
	width: 50%;
	height: 100%;
	overflow: hidden;
}
.case-item__beforeafter img {
	width: 100%;
    height: 100%;
    object-fit: cover;
	max-width: none;
	display: block;
}
.case-item__after {
	height: 100%;
}
.case-item__delimiter {
    position: absolute;
    left: 50%;
    top: 0;
    z-index: 10;
    width: 3px;
    height: 100%;
    background-color: #fff;
}
.case-item__delimiter:before {
	content: "";
    position: absolute;
    left: 50%;
    top: 50%;
    border-radius: 100%;
    width: 50px;
    height: 50px;
    background-color: #fff;
    transform: translate(-50%, -50%);
}
.case-item__delimiter span {
	position: absolute;
	width: 40px;
	height: 40px;
	left: -18px;
	top: 0;
	right: 0;
	bottom: 0;
	margin: auto;
	cursor: pointer;
}
.case-item__delimiter span:before,
.case-item__delimiter span:after {
	position: absolute;
	top: 0;
	bottom: 0;
	content: '';
	margin: auto;
	width: 10px;
	height: 10px;
}
.case-item__delimiter span:before {
	border-left: 2px solid #535353;
	border-top: 2px solid #535353;
	left: 5px;
	transform: rotate(-45deg);
}
.case-item__delimiter span:after {
	border-left: 2px solid #535353;
	border-top: 2px solid #535353;
	right: 5px;
	transform: rotate(135deg);
}
.case-item__content {
	flex: 1;
	padding: 0 0 0 30px;
}
.case-item__title {
	margin: 0 0 20px;
	font-family: 'MontserratSemiBold', sans-serif;
	font-size: 22px;
}
.case-item__stat {
	margin: 0 0 10px;
	line-height: 1.2;
}
.case-item__stat:last-child {
	margin: 0;
}
.case-item__stat span {
	font-family: 'MontserratSemiBold', sans-serif;
}
.case-item__bottom {
	margin: 20px 0 0;
	max-width: 290px;
	width: 100%;
	display: flex;
	align-items: center;
	padding: 20px 15px;
	border-radius: 10px;
	border: 2px dashed #eee;
}
.case-item-bottom__col {
	flex: 0 0 50%;
	max-width: 50%;
}
.case-item-bottom__title {
	margin: 0 0 10px;
	color: #535353;
}
.case-item-bottom__value {
	font-family: 'MontserratSemiBold', sans-serif;
}
.case-item-bottom__value--price {
	color: var(--main-color);
}
.case-item__order {
	margin: 20px 0 0;
}
.case-item__button {
	padding: 15px 25px;
	border: none;
	border-radius: 5px;
	background-color: var(--main-color);
	font-family: 'MontserratBold', sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.case-item__button:hover {
	background: #002E74;
}
.cases-slider .slick-arrow {
	position: absolute;
	z-index: 1;
	top: 0;
	bottom: 0;
	margin: auto;
	width: 50px;
	height: 50px;
	box-shadow: 4px 6px 20px rgba(0,0,0,0.2);
	border: none;
	border-radius: 50%;
	background-color: #fff;
	background-position: center;
	background-repeat: no-repeat;
	background-size: 18px 20px;
	color: transparent;
	font-size: 0;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.cases-slider .slick-prev {
	left: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
	transform: rotate(180deg);
}
.cases-slider .slick-next {
	right: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
}
.cases-slider .slick-arrow:hover {
	box-shadow: 4px 6px 20px rgba(0,0,0,0.4);
}





.casesb2b-top {
	max-width: 640px;
	width: 100%;
	margin: 0 auto;
}
.casesb2b-top .case-item__beforeafter {
	flex: 0 0 640px;
	max-width: 640px;
}
.casesb2b-main {
	display: none;
}
.casesb2b-main--active {
	display: block;
}
.casesb2b-items__row {
	display: flex;
	flex-wrap: wrap;
	margin: 0 -15px;
}
.casesb2b-items__col {
	margin: 20px 0 0;
	flex: 0 0 25%;
	max-width: 25%;
	padding: 0 15px;
}
.casesb2b-item {
	display: flex;
	overflow: hidden;
	position: relative;
	border-radius: 10px;
}
.casesb2b-item__before,
.casesb2b-item__after {
	flex: 0 0 50%;
	max-width: 50%;
	height: 140px;
}
.casesb2b-item__before img,
.casesb2b-item__after img {
	width: 100%;
	height: 100%;
	object-fit: cover;
}
.casesb2b-item__ico {
	position: absolute;
	left: 0;
	top: 0;
	right: 0;
	bottom: 0;
	margin: auto;
	width: 60px;
	height: 60px;
	border-radius: 50%;
	background: #fff;
}
.casesb2b-item__ico:before {
	position: absolute;
	left: 0;
	top: 0;
	right: 0;
	bottom: 0;
	margin: auto;
	content: '';
	width: 40px;
	height: 40px;
	background-size: 40px;
	background: url(../images/i/bef-after-eyeopen-icon.svg) center no-repeat;
}
.casesb2b-item--active .casesb2b-item__ico:before {
	background: url(../images/i/bef-after-eyeclose-icon.svg) center no-repeat;
}


/*----------------------------------------------------------------
CTA section
----------------------------------------------------------------*/

.s-cta {
	padding: 30px 0;
	background-color: var(--main-color);
}
.cta-container {
	margin: 0 auto;
	max-width: 1100px;
	background: #fff;
	padding: 15px 75px;
	box-shadow: 4px 6px 20px rgba(0,0,0,0.2);
	border-radius: 15px;
	display: flex;
	align-items: center;
	justify-content: space-between;
}
.cta-container__content {
	flex: 0 0 320px;
	max-width: 320px;
	color: #535353;
	text-align: center;
}
.cta-container__telnumber {
	font-family: 'MontserratSemiBold', sans-serif;
	color: #535353;
}
.cta-container__telnumber:hover {
	color: #18A0FB;
}
.cta-container__text {
	margin: 5px 0 0;
}
.cta-container__text span {
	font-family: 'MontserratBold', sans-serif;
	color: #18A0FB;
}
.cta-container__socials .soc-nav__item {
	margin: 0 5px;
}
.cta-container__socials .soc-nav__link {
	width: 58px;
	height: 58px;
	background-size: 58px;
}
.cta-container__button {
	flex: 0 0 300px;
	max-width: 300px;
	padding: 25px 0;
	border: none;
	border-radius: 5px;
	background-color: var(--main-color);
	font-family: 'MontserratBold', sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.cta-container__button:hover {
	opacity: 0.8;
}


/*----------------------------------------------------------------
Calc section
----------------------------------------------------------------*/

.s-calc {
	margin: 60px 0;
}
.calc-tabs__row {
	display: flex;
	margin: 0 -10px;
}
.calc-tabs__col {
	flex-grow: 1;
	padding: 0 10px;
}
.calc-tab {
	width: 100%;
	display: block;
	padding: 12px 5px;
	border: 2px solid var(--main-color);
	border-radius: 5px;
	background: #fff;
	box-shadow: 4px 6px 20px rgba(0, 0, 0, 0.2);
    font-size: 16px;
    line-height: 1;
	font-weight: 400;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.calc-tab--active {
	background: var(--main-color);
	color: #fff;
	box-shadow: none;
}
.calc-tab:hover {
	box-shadow: 4px 6px 20px rgba(0, 0, 0, 0.4);
}





.calc-body {
	margin: 15px 0 0;
}
.calc-content {
	display: none;
}
.calc-content--active {
	display: block;
}
.calc-grid__row {
	margin: 0 -10px;
	display: flex;
	flex-wrap: wrap;
}
.calc-grid__col {
	margin: 0 0 15px;
	padding: 0 10px;
	flex: 0 0 16.6666%;
	max-width: 16.6666%;
}
.calc-grid__col--chemicalpokritie {
	display: none;
}
.calc-grid__col--chemicalpokritie-active {
	display: block;
}
.calc-grid__fullcol {
	flex: 1;
}


.calc-head {
	margin: 0 0 0px;
    width: 100%;
    display: flex;
    min-height: 50px;
    align-items: center;
    color: #535353;
    font-family: 'ComfortaaBold', sans-serif;
	font-size: 18px;
    line-height: 1.2;
	font-weight: 700;
}
.calc-items {
	padding: 15px;
	border: 2px dashed #A3A3A3;
	border-radius: 15px;
}


.calc-grid-extended-chemical {
	display: none;
}
.calc-grid-extended-chemical--active {
	display: block;
}
.calc-extended {
	padding: 15px;
	border-radius: 15px;
	background: #fff;
	text-align: center;
}
.calc-extended__ico {
	height: 60px;
	text-align: center;
}
.calc-extended__ico img {
	height: 100%;
}
.calc-extended__title {
	margin: 5px 0;
    min-height: 60px;
    align-items: center;
    display: flex;
    width: 100%;
    justify-content: center;
	color: #535353;
	line-height: 1.2;
}
.calc-extended__price {
	margin: 0 0 10px;
	font-size: 20px;
	font-weight: 600;
}
.calc-radio {
	margin: 0 0 15px;
	display: block;
	position: relative;
}
.calc-radio:last-child {
	margin: 0;
}
.calc-radio input {
	position: absolute;
	z-index: -1;
	opacity: 0;
}
.calc-radio span {
    display: block;
    background: #fff;
    color: #535353;
    padding: 10px 5px;
    text-align: center;
    font-weight: 500;
    position: relative;
    border-radius: 5px;
    box-shadow: 4px 6px 20px rgb(0 0 0 / 20%);
    width: 100%;
    cursor: pointer;
	font-size: 14px;
	line-height: 1.1;
}
.calc-radio > input:checked + span {
    background: var(--main-color);
    color: #fff;
}
.horizontalcalc-radio {
	display: block;
	padding: 10px 20px;
	border-radius: 15px;
	border: 2px dashed #A3A3A3;
	font-size: 14px;
	line-height: 1.2;
	cursor: pointer;
}
.horizontalcalc-radio input {
	position: absolute;
	z-index: -1;
	opacity: 0;
}
.horizontalcalc-radio span {
	padding: 0 0 0 30px;
	position: relative;
    display: block;
    color: #535353;
    font-weight: 500;
    width: 100%;
    cursor: pointer;
	font-size: 14px;
	line-height: 1.2;
}
.horizontalcalc-radio span:before {
	position: absolute;
	left: 0;
	top: 0;
	bottom: 0;
	margin: auto;
	content: '';
    width: 20px;
    height: 20px;
    border: 1px solid #fff;
    border-radius: 5px;
    background-repeat: no-repeat;
    background-position: center center;
    background-size: 75% 100%;
    box-shadow: 4px 6px 20px rgb(0 0 0 / 20%);
}
.horizontalcalc-radio > input+ span:before {
	background-image: url(../images/i/i-check-grey.svg);
}
.horizontalcalc-radio > input:checked + span:before {
	background-image: url(../images/i/i-check-blue.svg);
}


.calc-items-sqr {
	display: none;
}
.calc-items-chemical {
	display: none;
}
.calc-items--active {
	display: block;
}



.calc-date-input,
.calc-select {
	height: 47px;
    width: 100%;
    background: #FFFFFF;
    box-shadow: 4px 6px 20px rgba(0, 0, 0, 0.2);
    border-radius: 5px;
    border: none;
    padding: 15px;
	font-size: 14px;
	color: #535353;
}
.calc-date-input {
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none;
}
.calc-select {
	cursor: pointer;
}





.calc-square {
	position: relative;
}
.calc-square input {
	width: 100%;
	height: 47px;
    width: 100%;
    background: #FFFFFF;
    box-shadow: 4px 6px 20px rgb(0 0 0 / 20%);
    border-radius: 5px;
    border: none;
    padding: 15px;
    font-size: 14px;
    color: #535353;
}
.calc-square span {
	position: absolute;
	right: 35px;
	top: 0;
	bottom: 0;
	margin: auto;
	font-size: 14px;
	line-height: 47px;
	color: #535353;
}

.calc-grid-extended {
	margin: 30px 0 0;
}
.calc-grid__fullcol .calc-grid-extended {
	margin: 0;
}
.calc-grid-extended__title {
	margin: 0 0 15px;
    color: #535353;
    font-family: 'ComfortaaBold', sans-serif;
	font-size: 18px;
    line-height: 1.2;
	font-weight: 700;
}
.calc-extended {
	padding: 15px;
    border: 2px dashed #A3A3A3;
    border-radius: 15px;
}



.calc-extended__add {
	height: 32px;
	width: 100%;
	display: block;
	background: var(--main-color);
	border: none;
	border-radius: 5px;
    color: #fff;
	font-size: 14px;
	line-height: 32px;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.calc-extended--active .calc-extended__add {
	display: none;
}
.calc-extended--active {
	background-color: var(--main-color);
	border-color: var(--main-color);
	color: #fff;
}
.calc-extended--active .calc-extended__title {
	color: #fff;
}
.calc-extended--active .calc-extended__inputs {
	display: block;
}


.calc-extended__inputs {
	position: relative;
	padding: 0 20px;
	display: none;
	border-radius: 5px;
	overflow: hidden;
	max-width: 100px;
	margin: 0 auto;
}
.calc-extended--active .calc-extended__ico img {
    filter: brightness(10);
}

.calc-extended__input {
	border: none;
	background-color: #fff;
	padding: 0 20px;
	width: 100%;
	height: 32px;
	text-align: center;
}
.calc-extended__minus,
.calc-extended__plus {
	position: absolute;
	top: 0;
	bottom: 0;
	border: none;
	margin: auto;
	font-size: 24px;
	width: 20px;
	height: 32px;
	background-color: #fff;
	line-height: 32px;
	cursor: pointer;
}
.calc-extended__minus {
	left: 0;
}
.calc-extended__plus {
	right: 0;
}






.calc-resultbox {
	position: fixed;
	left: 0;
	right: 0;
	margin: auto;
	max-width: 1000px;
	padding: 15px 30px;
	border-radius: 6px;
	bottom: 5px;
	background: var(--main-color);
	color: #535353;
	z-index: 11;
	opacity: 1;
	visibility: visible;
	transition: all 0.4s ease 0s;
}
.b2b .calc-result__button {
	background: #18A0FB;
}
.b2b .calc-result__button:hover {
	background: #18A0FB;
	opacity: 0.8;
}
.calc-resultbox--hidden {
	z-index: -1;
	opacity: 0;
	visibility: hidden;
}
.calc-resultbox__row {
	display: flex;
	align-items: center;
	
}
.calc-resultbox__left {
	flex: 1;
}
.calc-resultbox__left .calc-result-reset {
	display: none;
}
.calc-result-grid {
	padding: 10px 20px;	
	border-radius: 6px;
	background-color: #fff;
}
.calc-result-grid__row {
	display: flex;
	flex-wrap: wrap;
	margin: 0 -5px;
}
.calc-result-grid__col {
	margin: 10px 0;
	flex: 0 0 50%;
	max-width: 50%;
	padding: 0 5px;
}
.calc-result-item {
	position: relative;
	padding: 0 0 0 35px;
	font-size: 18px;
	color: #727171;
	font-family: 'MontserratMedium', sans-serif;	
}
.calc-result-item:before {
	position: absolute;
	left: 0;
	top: 0;
	bottom: 0;
	margin: auto;
	content: '';
	width: 24px;
	height: 24px;
	background-size: 24px;
}
.calc-result-item--clean:before {
	background: url(../images/i/i-housekeeping.png) no-repeat;
	background-size: 24px;
}
.calc-result-item--window:before {
	background: url(../images/i/i-window.png) no-repeat;
	background-size: 24px;
}
.calc-result-item--chemical:before {
	background: url(../images/i/i-vacuum.png) no-repeat;
	background-size: 24px;
}
.calc-result-item--disinfection:before {
	background: url(../images/i/i-disinfection.png) no-repeat;
	background-size: 24px;
}
.calc-resultbox__right {
	flex: 0 0 250px;
	max-width: 250px;
	text-align: center;
}
.calc-result-reset {
	position: relative;
	padding: 5px 5px 5px 20px;
	background-color: #f2f2f2;
	border: 1px solid #ccc;
	color: #535353;
	display: inline-block;
	border-radius: 5px;
}
.calc-result-reset:before {
	position: absolute;
	left: 5px;
	top: 0;
	bottom: 0;
	margin: auto;
	content: '';
	background: url(../images/i/i-close.svg) no-repeat;
	width: 12px;
	height: 12px;
	background-size: 12px;
}
.calc-result-total {
	margin: 10px 0;
	font-family: 'MontserratSemiBold', sans-serif;
	color: #fff;
	font-size: 18px;
}
.calc-result__button {
	padding: 10px 20px;
	border: none;
	border-radius: 5px;
	background: #FD7701;
	font-family: 'MontserratBold', sans-serif;
	color: #fff;
	font-size: 14px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.calc-result__button:hover {
	background: #002E74;
}


/*----------------------------------------------------------------
Cleaners section
----------------------------------------------------------------*/

.s-cleaners {
	margin: 30px 0;
}
.cleaners-slider {
	padding: 0 60px;
}
.b-cleaner__avatar img {
	border-radius: 10px;
}
.b-cleaner__name {
	margin: 15px 0 0;
	font-family: 'ComfortaaBold', sans-serif;
	font-size: 18px;
	text-align: center;
}
.b-cleaner-info {
	margin: 10px 0 0;
	display: flex;
	align-items: center;
	justify-content: center;
	color: #535353;
}
.b-cleaner-info__rating {
	position: relative;
	padding: 0 0 0 12px;
}
.b-cleaner-info__rating:before {
	position: absolute;
	left: 0;
	top: 0;
	bottom: 0;
	content: '';
	margin: auto;
	background: url(../images/i/i-star.svg) no-repeat;
	width: 10px;
	height: 10px;
	background-size: 10px;
}
.b-cleaner-info__cleancount {
	position: relative;
	padding: 0 0 0 15px;
	margin: 0 0 0 10px;
}
.b-cleaner-info__cleancount:before {
	position: absolute;
	left: 0;
	top: 0;
	bottom: 0;
	content: '';
	margin: auto;
	background: #000;
	width: 4px;
	height: 4px;
	border-radius: 50%;
}
.b-cleaner-more {
	margin: 10px 0 0;
	text-align: center;
}
.b-cleaner-more__btn {
	padding: 15px 25px;
	border: none;
	border-radius: 5px;
	background-color: var(--main-color);
	font-family: 'MontserratSemiBold', sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.b-cleaner-more__btn:hover {
	background: #002E74;
}
.modal-cleaner__avatar img {
	border-radius: 10px;
}
.modal-cleaner__name {
	margin: 15px 0 0;
	font-family: 'MontserratSemiBold', sans-serif;
	font-size: 20px;
	text-align: center;
}
.modal-cleaner__info {
	margin: 15px 0 0;
	display: flex;
	align-items: center;
	justify-content: center;
	color: #535353;
}
.modal-cleaner__rating {
	position: relative;
	padding: 0 0 0 12px;
}
.modal-cleaner__rating:before {
	position: absolute;
	left: 0;
	top: 0;
	bottom: 0;
	content: '';
	margin: auto;
	background: url(../images/i/i-star.svg) no-repeat;
	width: 10px;
	height: 10px;
	background-size: 10px;
}
.modal-cleaner__cleancount {
	position: relative;
	padding: 0 0 0 15px;
	margin: 0 0 0 10px;
}
.modal-cleaner__cleancount:before {
	position: absolute;
	left: 0;
	top: 0;
	bottom: 0;
	content: '';
	margin: auto;
	background: #000;
	width: 4px;
	height: 4px;
	border-radius: 50%;
}
.modal-cleaner__stats {
	margin: 15px 0 0;
}
.modal-cleaner-stat {
	margin: 0 0 7px 0;
	display: flex;
	align-items: center;
}
.modal-cleaner-stat:last-child {
	margin: 0;
}
.modal-cleaner-stat__name {
	flex: 0 0 105px;
	max-width: 105px;
}
.modal-cleaner-stat__value {
	display: flex;
}
.modal-cleaner-stat__value span {
	margin: 0 3px 0 0;
	flex: 0 0 15px;
	max-width: 15px;
	height: 20px;
	border-radius: 5px;
	border: 1px solid #ccc;
}
.modal-cleaner__startworkyear {
	margin: 15px 0 0 0;
	color: #535353;
}
.cleaners-slider .slick-list {
	margin: 0 -15px;
}
.cleaners-slider .slick-slide {
	margin: 0 15px;
}
.cleaners-slider .slick-arrow {
	position: absolute;
	z-index: 1;
	top: 0;
	bottom: 0;
	margin: auto;
	width: 50px;
	height: 50px;
	box-shadow: 4px 6px 20px rgba(0,0,0,0.2);
	border: none;
	border-radius: 50%;
	background-color: #fff;
	background-position: center;
	background-repeat: no-repeat;
	background-size: 18px 20px;
	color: transparent;
	font-size: 0;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.cleaners-slider .slick-prev {
	left: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
	transform: rotate(180deg);
}
.cleaners-slider .slick-next {
	right: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
}
.cleaners-slider .slick-arrow:hover {
	box-shadow: 4px 6px 20px rgba(0,0,0,0.4);
}


/*----------------------------------------------------------------
Actions section
----------------------------------------------------------------*/

.s-actions {
	margin: 60px 0 30px;
}
.actions-grid--page {
	margin: 0 0 20px;
}
.actions-grid__title {
	position: relative;
	margin: 0 0 30px;
	padding: 25px 0 0;
    font-family: "MontserratMedium", sans-serif;
    color: #1b1b1b;
    font-size: 24px;
    font-weight: 400;
	text-align: center;
}
.actions-grid__title:before {
	position: absolute;
	left: 0;
	top: 0;
	right: 0;
	margin: auto;
	content: '';
	width: 80px;
	height: 6px;
	border-radius: 5px;
	background: #18A0FB;
}
.actions-grid__row {
	margin: 0 -15px;
	display: flex;
	flex-wrap: wrap;
}
.actions-grid__col {
	margin: 0 0 30px;
	padding: 0 15px;
	flex: 0 0 25%;
	max-width: 25%;
}
.b-action {
	display: flex;
	flex-direction: column;
	justify-content: space-between;
	overflow: hidden;
	min-height: 270px;
	padding: 20px 15px;
	border-radius: 10px;
	position: relative;
	border: 1px dashed #535353;
	height: 100%;
	background: #fff;
	color: #000;
	transition: all 0.4s ease 0s;
	background: rgba(0,175,242,0.1);
}
.b-action.white-font {
	color: #fff;
	border: none;
}
.b-action__ico {
	position: absolute;
	z-index: 1;
	right: -50px;
	top: 60px;
	max-width: 180px;
}
.b-action--archive .b-action__ico {
	top: auto;
	bottom: 0;
}
.b-action__title {
	margin: 0 0 25px;
	font-family: "ComfortaaBold", sans-serif;
    font-size: 18px;
}
.b-action__description {
	padding: 0 100px 0 0;
	margin: 25px 0 0;
	font-size: 16px;
	line-height: 1.1;
}
.b-action__date {
	margin: 25px 0 0;
	font-size: 14px;
}
.b-action__more {
	margin: 60px 0 0;
	text-align: center;
}
.b-action__btn {
	display: block;
	width: 100%;
	padding: 10px;
	border-radius: 5px;
	border: none;
	background: var(--main-color);
	font-family: "MontserratSemiBold", sans-serif;
	color: #000;
	font-size: 16px;
	transition: all 0.4s ease 0s;
	cursor: pointer;
}
.white-font .b-action__btn {
	background: #fff;
}
.b-action__btn:hover {
	background: #002E74;
	color: #fff;
}
.b-action__code {
	margin: 0 0 15px;
	position: relative;
	border: 1px solid #535353;
	width: 100%;
	height: 44px;
	border-radius: 5px;
	background: #fff;
	padding: 0 40px 0 15px;
	font-size: 14px;
	color: #535353;
	line-height: 44px;
	text-align: left;
}
.b-action__code span {
	font-family: "MontserratSemiBold", sans-serif;
}
.b-action__copy {
	position: absolute;
	right: 5px;
	top: 0;
	bottom: 0;
	margin: auto;
	background: url(../images/i/i-copy.png) no-repeat;
	border: none;
	width: 24px;
	height: 24px;
	background-size: 24px;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.b-action__copy:hover {
	opacity: 0.7;
}
.copy-status {
	position: absolute;
	z-index: -1;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	opacity: 0;
	visibility: hidden;
	border-radius: 5px;
	background-color: #0fcc45;
	font-size: 15px;
	line-height: 44px;
	text-align: center;
	color: #fff;
	transition: all 0.4s ease 0s;
}
.copy-status--active {
	opacity: 1;
	visibility: visible;
	z-index: 1;
}
.actions-more {
	text-align: center;
}
.actions-more__link {
	display: inline-block;
	padding: 15px 35px;
	border-radius: 5px;
	border: none;
	background: #18A0FB;
	font-family: "MontserratSemiBold", sans-serif;
	color: #fff;
	font-size: 16px;
	transition: all 0.4s ease 0s;
	cursor: pointer;
}
.actions-more__link:hover {
	background: #002E74;
	color: #fff;
}


/*----------------------------------------------------------------
Videos section
----------------------------------------------------------------*/

.s-videos {
	padding: 30px 0;
}
.videos-grid__row {
	display: flex;
	flex-wrap: wrap;
	margin: 0 -15px;
}
.videos-grid__col {
	flex: 0 0 25%;
	max-width: 25%;
	padding: 0 15px;
	margin: 0 0 30px;
}
.videos-grid__col:not(:nth-child(-n+8)) {
	display: none;
}
.b-video {
	height: 100%;
	padding: 5px;
	border-radius: 15px;
	box-shadow: 4px 6px 20px rgba(0, 0, 0, 0.2);
	background: #fff;
}
.b-video__bg {
	position: relative;
    display: block;
    overflow: hidden;
    border-radius: 15px 15px 0 0;
    background-color: #8d8d8d;
    padding: 0 0 75%;
}
.b-video__bg img {
	position: absolute;
	left: 0;
	top: 0;
	width: 100%;
	height: 100%;
	object-fit: cover;
}
.b-video__play {
    position: absolute;
    left: 0;
    top: 0;
    right: 0;
    bottom: 0;
    margin: auto;
    border: 1px solid #fff;
    border-radius: 50%;
    width: 80px;
    height: 80px;
    transition: all 0.4s ease 0s;
}
.b-video__play:before {
	position: absolute;
    left: 0;
    top: 0;
    right: -7px;
    bottom: 0;
    margin: auto;
    content: '';
    display: inline-block;
    width: 0;
    height: 0;
    border-style: solid;
    border-width: 15px 0 15px 24px;
    border-color: transparent transparent transparent #fff;
    transition: all 0.4s ease 0s;
}
.b-video__content {
	padding: 20px 15px;
}
.b-video__title {
	font-family: 'ComfortaaBold', sans-serif;
	font-size: 18px;
}
.videos-more {
	text-align: center;
}
.videos-more__button {
	display: inline-block;
	padding: 10px 20px;
	border: none;
	border-radius: 5px;
	background-color: var(--main-color);
	font-family: 'MontserratBold', sans-serif;
	color: #fff;
	font-size: 14px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.videos-more__button:hover {
	background: #002E74;
}


/*----------------------------------------------------------------
Steps section
----------------------------------------------------------------*/

.s-steps {
	margin: 30px 0;
}
.steps-grid__row {
	display: flex;
	flex-wrap: wrap;
	margin: 0 -15px;
}
.steps-grid__col {
	flex: 0 0 25%;
	max-width: 25%;
	padding: 0 15px;
	margin: 0 0 30px;
}
.b-step {
	text-align: center;
}
.b-step__ico  {
	height: 90px;
}
.b-step__ico img {
	max-width: 90px;
	max-height: 90px;
}
.b-step__title {
	min-height: 44px;
	margin: 15px 0 0;
	font-family: 'ComfortaaBold', sans-serif;
	font-size: 18px;
	color: #535353;
}
.b-step__description {
	margin: 10px 0 0;
	color: #535353;
	line-height: 1.2;
}
.b-step__more {
	margin: 15px 0 0;
}
.b-step__btn {
	display: inline-block;
	border-radius: 5px;
	background: var(--main-color);
	border: none;
	padding: 15px 35px;
	cursor: pointer;
	font-family: "MontserratSemiBold", sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	transition: all 0.4s ease 0s;
	cursor: pointer;
}
.b-step__btn:hover {
	background: #002E74;
}
.b-step__tel {
	margin: 10px 0 0;
	text-align: center;
}
.b-step__telnumber {
	font-family: "MontserratBold", sans-serif;
    color: #000;
    font-size: 16px;
}
.b-step__telnumber:hover {
	color: #002147;
}


/*----------------------------------------------------------------
Letters section
----------------------------------------------------------------*/

.s-letters {
	margin: 30px 0;
}
.letters-grid__row {
	display: flex;
	flex-wrap: wrap;
	margin: 0 -15px;
}
.letters-grid__col {
	margin: 0 0 30px;
	padding: 0 15px;
	flex: 0 0 25%;
	max-width: 25%;
}
.letters-grid__link {
	display: block;
	border: 1px solid #dde5eb;
	border-radius: 10px;
	overflow: hidden;
}


/*----------------------------------------------------------------
Partners section
----------------------------------------------------------------*/

.s-partners {
	margin: 30px 0;
}
.partners-slider {
	padding: 0 60px;
}
.partners-slider .slick-list {
	margin: 0 -15px;
}
.partners-slider__col {
	margin: 0 15px;
}
.partner-item {
	overflow: hidden;
	border: 1px dashed #000;
	border-radius: 15px;
	display: flex;
	flex-direction: column;
	align-items: center;
	justify-content: center;
	overflow: hidden;
}
.partners-slider .slick-arrow {
	position: absolute;
	z-index: 1;
	top: 0;
	bottom: 0;
	margin: auto;
	width: 50px;
	height: 50px;
	box-shadow: 4px 6px 20px rgba(0,0,0,0.2);
	border: none;
	border-radius: 50%;
	background-color: #fff;
	background-position: center;
	background-repeat: no-repeat;
	background-size: 18px 20px;
	color: transparent;
	font-size: 0;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.partners-slider .slick-prev {
	left: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
	transform: rotate(180deg);
}
.partners-slider .slick-next {
	right: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
}
.partners-slider .slick-arrow:hover {
	box-shadow: 4px 6px 20px rgba(0,0,0,0.4);
}


/*----------------------------------------------------------------
Clients section
----------------------------------------------------------------*/

.s-clients {
	margin: 60px 0;
}
.clients-slider {
	padding: 0 60px;
}
.clients-slider .slick-arrow {
	position: absolute;
	z-index: 1;
	top: 0;
	bottom: 0;
	margin: auto;
	width: 50px;
	height: 50px;
	box-shadow: 4px 6px 20px rgba(0,0,0,0.2);
	border: none;
	border-radius: 50%;
	background-color: #fff;
	background-position: center;
	background-repeat: no-repeat;
	background-size: 18px 20px;
	color: transparent;
	font-size: 0;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.clients-slider .slick-prev {
	left: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
	transform: rotate(180deg);
}
.clients-slider .slick-next {
	right: 0;
	background-image: url(../images/i/i-arrow-blue-right.svg);
}
.clients-slider .slick-arrow:hover {
	box-shadow: 4px 6px 20px rgba(0,0,0,0.4);
}
.clients-slider-item {
	display: flex;
}
.clients-slider-item__img {
	flex: 0 0 640px;
	max-width: 640px;
}
.clients-slider-item__img img {
	border-radius: 10px;
}
.clients-slider-item__content {
	padding: 0 0 0 15px;
	flex: 1;
}
.clients-slider-item__ico {
	max-width: 120px;
}
.clients-slider-item__title {
	margin: 20px 0 0;
	font-family: 'MontserratSemiBold', sans-serif;
	font-size: 24px;
}
.clients-slider-item-services {
	margin: 20px 0 0;
}
.clients-slider-item-services__title {
	margin: 0 0 15px;
	font-size: 20px;
	line-height: 1.1;
}
.clients-slider-item-services__list li {
	position: relative;
	margin: 0 0 7px;
	padding: 0 0 0 15px;
	color: #535353;
	font-size: 16px;
	line-height: 1.1;
}
.clients-slider-item-services__list li:last-child {
	margin: 0;
}
.clients-slider-item-services__list li:before {
	position: absolute;
	left: 0;
	top: 8px;
	content: '';
	background: var(--main-color);
	width: 10px;
	height: 1px;
}
.clients-slider-item-letter {
	margin: 15px 0 0;
}
.clients-slider-item-letter__button {
	padding: 15px 25px;
	border: none;
	border-radius: 5px;
	background-color: var(--main-color);;
	font-family: 'MontserratBold', sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.clients-slider-item-letter__button:hover {
	background: #002E74;
}
.clients-slider .slick-dots {
	margin: 15px 0 0;
	display: flex;
	align-items: center;
	justify-content: center;
}
.clients-slider .slick-dots li {
	margin: 0 10px;
	font-size: 0;
}
.clients-slider .slick-dots button {
	width: 12px;
	height: 12px;
	border: 2px solid var(--main-color);
	border-radius: 50%;
	background: #fff;
	padding: 0;
	margin: 0;
	cursor: pointer;
	font-size: 0;
	transition: all 0.4s ease 0s;
}
.clients-slider .slick-dots .slick-active button,
.clients-slider .slick-dots .slick-active button:hover {
	background: var(--main-color);
	border-color: var(--main-color);
}
.clients-slider .slick-dots button:hover {
	border-color: #002E74;
}


/*----------------------------------------------------------------
FAQ section
----------------------------------------------------------------*/

.s-faq {
	margin: 60px 0;
}
.b-faqs {
	max-width: 1000px;
	margin: 0 auto;
}
.b-faq {
	margin: 0 0 15px;
	border-radius: 5px;
	color: #fff;
	background: var(--main-color);
	transition: all 0.4s ease 0s;
}
.b-faq--opened {
	box-shadow: 4px 6px 20px rgba(0,0,0,0.2);
	background: #fff;
}
.b-faq:last-child {
	margin: 0;
}
.b-faq__title {
	padding: 15px 40px 15px 15px;
	position: relative;
	border: none;
	width: 100%;
	background: transparent;
	font-family: 'MontserratSemiBold', sans-serif;
	color: #fff;
	font-size: 18px;
	text-align: left;
	cursor: pointer;
}
.b-faq__title:before {
	position: absolute;
	right: 15px;
	top: 0;
	bottom: 3px;
	margin: auto;
	content: '';
	width: 14px;
	height: 14px;
	border-top: 2px solid #fff;
	border-right: 2px solid #fff;
	transform: rotate(135deg);
	transition: all 0.4s ease 0s;
}
.b-faq--opened .b-faq__title {
	color: #000;
}
.b-faq--opened .b-faq__title:before {
	border-top: 2px solid #000;
	border-right: 2px solid #000;
	transform: rotate(315deg);
}
.b-faq__dropdown {
	display: none;
}
.b-faq__text {
	padding: 0 15px 15px 15px;
	color: #000;
	font-size: 16px;
	line-height: 1.2;
}


/*----------------------------------------------------------------
Vacancies section
----------------------------------------------------------------*/

.s-vacancies {
	margin: 60px 0;
}
.vacancy-item {
	margin: 0 0 30px;
	border-radius: 5px;
	border: 1px solid #535353;
	position: relative;
	color: #000;
	background-color: #f2f2f2;
}
.vacancy-item:last-child {
	margin: 0;
}
.vacancy-item__content {
	padding: 25px 15px;
	position: relative;
}
.vacancy-item__title {
	margin: 0 0 15px;
	font-family: 'ComfortaaBold', sans-serif;
	font-size: 20px;
}
.vacancy-item__payment {
	margin: 0 0 10px;	
}
.vacancy-item__address {
	margin: 10px 0 0;
}
.vacancy-item__actions {
	margin: 15px 0 0;
}
.vacancy-item__respond {
	padding: 12px 20px;
    border: none;
    border-radius: 5px;
    background-color: #18a0fb;
    font-family: 'MontserratSemiBold', sans-serif;
    color: #fff;
    font-size: 15px;
    line-height: 1;
    text-align: center;
    cursor: pointer;
    transition: all 0.4s ease 0s;
}
.vacancy-item__respond:hover {
	background: #002E74;
}
.vacancy-item__drop {
	display: none;
}
.vacancy-item__description {
	padding: 15px;
	line-height: 1.2;
}
.vacancy-item__dropbtn {
	position: absolute;
	right: 10px;
	bottom: 10px;
	content: '';
	background-color: transparent;
	width: 0px;
	height: 0px;
	border-style: solid;
	border-width: 14px 14px 0 14px;
	border-color: #535353 transparent transparent transparent;
	transform: rotate(0deg);
	transition: all 0.4s ease 0s;
	cursor: pointer;
}
.vacancy-item__dropbtn--active {
	border-color: #008AE7 transparent transparent transparent;
}


/*----------------------------------------------------------------
Inventory section
----------------------------------------------------------------*/

.s-inventories {
	margin: 60px 0 30px;
}
.inventories-tabs {
	margin: 0 0 30px;
	display: flex;
	align-items: center;
	justify-content: center;
}
.inventory-tab {
	margin: 0 10px;
	padding: 12px 25px;
	border-radius: 5px;
	background: #fff;
	border: 2px solid var(--main-color);
	color: #535353;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.inventory-tab--active {
	background-color: var(--main-color);
	color: #fff;
}
.b-inventory-tabitem {
	display: none;
}
.b-inventory-tabitem--active {
	display: block;
}
.b-inventory-grid__row {
	display: flex;
	flex-wrap: wrap;
	justify-content: center;
	margin: 0 -15px;
}
.b-inventory-grid__col {
	flex: 0 0 25%;
	max-width: 25%;
	padding: 0 15px;
	margin: 0 0 30px;
}
.b-inventory-item__img {
	min-height: 100px;
	overflow: hidden;
	border-radius: 10px;
}
.b-inventory-item__content {
	margin: 10px 0 0;
	padding: 15px;
	border-radius: 10px;
	border: 1px dashed #535353;
}
.b-inventory-item__title {
	font-family: 'ComfortaaBold', sans-serif;
	font-size: 18px;
	min-height: 55px;
}
.b-inventory-item__description {
	margin: 10px 0 0;
	color: #535353;
	font-size: 16px;
	line-height: 1.2;
}


/*----------------------------------------------------------------
Section navigation
----------------------------------------------------------------*/

.s-navigation {
	margin: 60px 0;
}
.navigation ul {
	margin: 0 -5px;
	display: flex;
	justify-content: center;
	text-align: center;
}
.navigation__item {
	padding: 0 5px;
}
.navigation__link {
	padding: 12px 25px;
	display: flex;
	align-items: center;
	justify-content: center;
	height: 100%;
	box-shadow: 0px 5px 15px rgba(116, 116, 116, 0.3);
	border: none;
	background: var(--main-color);
	border-radius: 5px;
	font-family: "MontserratSemiBold", sans-serif;
	color: #fff;
	font-size: 16px;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.navigation__link--active {
	background: #fff;
	color: #535353;
}
.navigation__link:hover {
	box-shadow: 0px 5px 15px rgba(116, 116, 116, 0.6);
}


/*----------------------------------------------------------------
Prices section
----------------------------------------------------------------*/

.s-prices {
	margin: 60px 0 30px;
}
.prices-grid__row {
	display: flex;
	flex-wrap: wrap;
	margin: 0 -15px;
}
.prices-grid__col {
	flex: 0 0 25%;
	max-width: 25%;
	margin: 0 0 30px 0;
	padding: 0 15px;
}
.prices-accordion {
	box-shadow: 4px 6px 15px rgba(0,0,0,0.2);
	border-radius: 5px;
	overflow: hidden;
}
.prices-accordion--opened {
	box-shadow: 4px 6px 15px rgba(0,0,0,0.4);
}
.prices-accordion__dropdown {
	display: none;
	padding: 0 15px 15px;
}
.prices-accordion__title {
	padding: 15px 20px 15px 15px;
	position: relative;
	border: none;
	width: 100%;
	background: #fff;
	font-family: 'MontserratSemiBold', sans-serif;
	color: #535353;
	font-size: 14px;
	text-align: left;
	cursor: pointer;
}
.prices-accordion__title:after {
	position: absolute;
	right: 10px;
	top: 0;
	bottom: 2px;
	margin: auto;
	content: '';
	width: 10px;
	height: 10px;
	border-top: 2px solid #535353;
	border-right: 2px solid #535353;
	transform: rotate(135deg);
	transition: all 0.4s ease 0s;
}
.price-accordion--opened .prices-accordion__title:after {
	transform: rotate(315deg);
}
.price-accordion-item {
	padding: 0 0 10px;
	margin: 10px 0;
	border-bottom: 1px solid #535353;
}
.price-accordion-item:last-child {
	padding: 0;
	margin: 10px 0 0 0;
	border: none;
}
.price-accordion-item__title {
	font-size: 14px;
	line-height: 1.1;
}
.price-accordion-item__bottom {
	margin: 5px 0 0;
	display: flex;
	flex-wrap: wrap;
	align-items: center;
	justify-content: space-between;
}
.price-accordion-item__price {
	font-family: 'MontserratSemiBold', sans-serif;
	font-size: 16px;
}
.price-accordion-item__btn {
	padding: 8px 12px;
	border: none;
	border-radius: 5px;
	background-color: #18a0fb;
	font-family: 'MontserratSemiBold', sans-serif;
	color: #fff;
	font-size: 14px;
	line-height: 1;
	text-align: center;
	cursor: pointer;
	transition: all 0.4s ease 0s;
}
.price-accordion-item__btn:hover {
	background: #002E74;
}


/*----------------------------------------------------------------
Reviews section
----------------------------------------------------------------*/

.s-reviews {
	margin: 60px 0;
}


/*----------------------------------------------------------------
Pagination
----------------------------------------------------------------*/

.pagination__row {
	margin: 0 -3px;
	display: flex;
	align-items: center;
}
.pagination--right {
	margin: 0 0 30px;
}
.pagination--center .pagination__row {
	justify-content: center;
}
.pagination--right .pagination__row {
	justify-content: flex-end;
}
.pagination .page-numbers {
	margin: 3px;
	width: 36px;
	height: 36px;
	border: 1px solid #000;
	font-size: 14px;
	line-height: 34px;
	text-align: center;
}
.pagination .page-numbers:hover {
	border-color: #008AE7;
	color: #008AE7;
}
.pagination .current {
	border-color: #008AE7;
	color: #008AE7;
	background-color: #008AE7;
	color: #fff;
	font-weight: 600;
}
.pagination .current:hover {
	color: #fff;
}


/*----------------------------------------------------------------
Breadcrumbs section
----------------------------------------------------------------*/

.s-breadcrumbs {
	padding: 20px 0;
}
.b2b .s-breadcrumbs {
	color: #fff;
}
.page-template-page-contacts .s-breadcrumbs,
.page-template-page-about .s-breadcrumbs,
.single-services .s-breadcrumbs {
	background-color: var(--main-color);
}
.breadcrumbs-nav,
.breadcrumbs-nav ul {
	display: flex;
	align-items: center;
	flex-wrap: wrap;
}
.breadcrumbs-nav li,
.breadcrumbs-nav a,
.breadcrumbs-nav span {
	font-size: 16px;
}
.breadcrumbs-nav .breadcrumb_last {
	color: #535353;
}
.page-template-page-contacts .breadcrumbs-nav .breadcrumb_last,
.page-template-page-about .breadcrumbs-nav .breadcrumb_last,
.single-services .breadcrumbs-nav .breadcrumb_last {
	color: #fff;
}
.breadcrumbs-nav a {
	color: #000;
}
.b2b .breadcrumbs-nav a {
	color: #fff;
}
.breadcrumbs-nav a:hover {
	color: #002E74;
}
.b2b .breadcrumbs-nav a:hover {
	color: #fff;
}
.breadcrumb-separator {
	display: inline-block;
	margin: 0 25px;
	background: url(../images/i/i-right-arr-black.svg) center no-repeat;
	width: 7px;
	height: 20px;
	background-size: 7px 12px;
}
.page-head {
	margin: 0 0 50px;
}
.page-head--404 {
	margin: 100px 0;
	text-align: center;
}
.page-title__404 {
	font-family: "MontserratSemiBold", sans-serif;
    color: #E67E23;
    font-size: 100px;
    line-height: 1;
    font-weight: 400;
}
.page-title {
	margin: 0 0 50px;
	position: relative;
	z-index: 1;
	font-family: "MontserratSemiBold", sans-serif;
    color: #323030;
    font-size: 42px;
    line-height: 51px;
    font-weight: 400;
}
.page-title span {
	color: var(--main-color);
}


/*----------------------------------------------------------------
Entry content
----------------------------------------------------------------*/

.entry-content h1 {
    margin: 0 0 30px 0;
	font-family: "MontserratSemiBold", sans-serif;
	font-size: 42px;
	line-height: 1.1;
    font-weight: 400;
}
.entry-content h2,
.entry-content h3,
.entry-content h4,
.entry-content h5 {
	margin: 50px 0 30px;
	font-family: "MontserratSemiBold", sans-serif;
	line-height: 1.1;	
	font-weight: 400;
}
.entry-content h2:first-child,
.entry-content h3:first-child,
.entry-content h4:first-child,
.entry-content h5:first-child {
	margin: 0 0 30px;
}
.entry-content h2 {
	font-size: 36px;
}
.entry-content h3 {
	font-size: 32px;
}
.entry-content h4 {
	font-size: 26px;
}
.entry-content p {
	color: #535353;
	font-size: 18px;
	line-height: 1.2;
	margin: 0 0 20px 0;
}
.entry-content p:last-child {
	margin: 0;
}
.entry-content strong {	
	font-family: "MontserratSemiBold", sans-serif;
	color: #535353;
	font-weight: 400;
}
.entry-content a {
	color: #FDB027;
	text-decoration: underline;
}
.entry-content a:hover {
	color: #E67E23;
	text-decoration: none;
}
.entry-content blockquote {
	position: relative;
	overflow: hidden;
	margin: 20px 0;
	background: #FFE3B0;
	border-radius: 10px;
	padding: 25px 40px;
	color: #535353;
}
.entry-content blockquote p {
	margin: 0 0 20px 0;
	color: #535353;
	font-size: 18px;
	line-height: 1.2;
}
.entry-content blockquote p:last-child {
	margin: 0;
}
.entry-content ul,
.entry-content ol {
	margin: 20px 0;
}
.entry-content ol {
	counter-reset: number;	
}
.entry-content ul li,
.entry-content ol li {
	position: relative;
	margin: 0 0 10px 0;
	padding: 0 0 0 18px;
	color: #535353;
	font-size: 18px;
	line-height: 1.2;
}
.entry-content ul li:before,
.entry-content ol li:before {
	position: absolute;
	left: 0;
	content: '';
}
.entry-content ul li:before {
	top: 6px;
	width: 8px;
	height: 8px;
	background: #E67E23;
	-webkit-border-radius: 50%;
	-moz-border-radius: 50%;
	-ms-border-radius: 50%;
	-o-border-radius: 50%;
	border-radius: 50%;
}
.entry-content ol li:before {
    top: 0;
    font-weight: 700;
    color: #E67E23;
    font-size: 18px;
    line-height: 1.2;
    counter-increment: number;
    content: counter(number);
}


/*----------------------------------------------------------------
Prefooter mainform section
----------------------------------------------------------------*/

.s-mainform {
	margin: 60px 0;
}
.mainform-box {
	margin: 0 auto;
	max-width: 700px;
	padding: 15px;
	border-radius: 15px;
	background: #fff;
	width: 100%;
	display: flex;
	box-shadow: 4px 6px 20px rgba(0, 0, 0, 0.2);
}
.mainform-box__img {
	flex: 0 0 375px;
	max-width: 375px;
}
.mainform-box__right {
	padding: 0 0 0 30px;
	flex: 1;
}
.mainform__group {
	margin: 0 0 15px 0;
}
.mainform__group:last-child {
	margin: 0;
}
.mainform__input {
	width: 100%;
	height: 40px;
	background: #fff;
	border: 1px solid #2b2a29;
	border-radius: 5px;
	padding: 0 15px;
	color: #2b2a29;
	font-size: 16px;
	line-height: 40px;
	text-align: left;
	-webkit-transition: all 0.4s ease 0s;
	-o-transition: all 0.4s ease 0s;
	transition: all 0.4s ease 0s;
}
.mainform__input::-webkit-input-placeholder {
	color: #535353;
	opacity: 1;
}
.mainform__input::-moz-placeholder {
	color: #535353;
	opacity: 1;
}
.mainform__input:-ms-input-placeholder {
	color: #535353;
	opacity: 1;
}
.mainform__input:-moz-placeholder {
	color: #535353;
	opacity: 1;
}
.mainform__input:focus {
	border: 1px solid #323030;
}
.mainform__input.error {
	border-color: red;
}
.mainform__submit {
	display: inline-block;
	width: 100%;
	border-radius: 5px;
	background: var(--main-color);
	border: none;
	padding: 15px;
	cursor: pointer;
	font-family: "MontserratSemiBold", sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	transition: all 0.4s ease 0s;
	cursor: pointer;
}
.mainform__submit:hover {
	background: #002E74;
}
.mainform-contacts__tel {
	margin: 15px 0 0;
}
.mainform-contacts__telnum {
	color: #535353;
}
.mainform-contacts__telnum:hover {
	color: #002E74;
}
.mainform-contacts__soc {
	margin: 15px 0 0;
}
.mainform-contacts__soc .soc-nav__item {
	margin: 0 5px 0 0;
}
.mainform-policy {
	margin: 30px 0;
	font-size: 14px;
	color: #535353;
}
.mainform-policy a {
	color: #002E74;
	text-decoration: underline;
}





.page-content {
	margin: 30px 0 0;
}
.contacts-container {
	display: flex;
}
.contacts-container__map {
	flex: 0 0 600px;
}
.contacts-container__side {
	padding: 0 0 0 30px;
	flex: 1;
}
.contacts-box {
	padding: 20px 15px;
	background: #fff;
	border-radius: 10px;
}
.contacts-box__title {
	margin: 0 0 10px;
	font-size: 20px;
}
.contacts-box-item {
	display: flex;
	align-items: center;
}
.contacts-box__row {
	display: flex;
	flex-wrap: wrap;
	margin: 0 -5px;
}
.contacts-box__col {
	margin: 10px 0;
	padding: 0 5px;
	flex: 0 0 50%;
	max-width: 50%;
}
.contacts-box-item__ico {
	margin: 0 10px 0 0;
	flex: 0 0 44px;
	max-width: 44px;
	height: 44px;
	border-radius: 50%;
	background-color: #e8ecf2;
	background-position: center;
	background-repeat: no-repeat;
	background-size: 24px;
}
.contacts-box-item--tg .contacts-box-item__ico {
	background-image: url(../images/i/i-tg.svg);
}
.contacts-box-item--email .contacts-box-item__ico {
	background-image: url(../images/i/i-emails.png);
}
.contacts-box-item--wa .contacts-box-item__ico {
	background-image: url(../images/i/i-whatsapp.svg);
}
.contacts-box-item--address .contacts-box-item__ico {
	background-image: url(../images/i/i-location.png);
}
.contacts-box-item--tel .contacts-box-item__ico {
	background-image: url(../images/i/i-call.png);
}
.contacts-box-item__title {
	margin: 0 0 7px;
	color: #535353;
}
.contacts-box-item__value {
	color: #000;
	font-family: "MontserratBold", sans-serif;
  	font-size: 15px;
}
.contacts-box-item__value a {
	color: #000;
	font-family: "MontserratBold", sans-serif;
  	font-size: 15px;
}
.contacts-box-item__value a:hover {
	color: #002147;
}


/*----------------------------------------------------------------
Footer
----------------------------------------------------------------*/

.footer {
	margin: 60px 0 0;
	padding: 40px 0;
    background: #eee;
}
.footer__inner {
	display: flex;
	align-items: center;
	justify-content: space-between;
}
.footer__row {
	display: flex;
}
.footer-logo {
	flex: 0 0 175px;
	max-width: 175px;
}
.footer-requisites {
	margin: 30px 0 0;
}
.footer-requisites__content {
	color: #535353;
	font-size: 14px;
	line-height: 1.2;
}
.footer-contacts {
	flex: 0 0 260px;
	max-width: 260px;
}
.footer-navigates {
	padding: 0 30px;
	flex: 1;
}
.footer-navigates-box {
	margin: 0 0 30px;
}
.footer-navigates-box:last-child {
	margin: 0;
}
.footer-navigates__heading,
.footer-navigates__headinglink {
	font-family: 'MontserratSemiBold', sans-serif;
	font-size: 18px;
	color: #1b1b1b;
}
.footer-navigates__heading {
	margin: 0 0 15px;
}
.footer-navigates__headinglink:hover {
	color: #18A0FB;
}
.footer-navigates__row {
	display: flex;
	margin: 0 -5px;
}
.footer-navigates__col {
	flex: 0 0 33.3333%;
	max-width: 33.33333%;
	padding: 0 5px;
}
.footer-nav li,
.footer-nav a {
	font-size: 16px;
	color: #535353;
}
.footer-nav li {
	margin: 0 0 10px;
}
.footer-nav li:last-child {
	margin: 0;
}
.footer-nav a:hover {
	color: #18A0FB;
}
.footer__address,
.footer__ordertime,
.footer__email,
.footer-tel,
.footer-soc,
.footer-order {
	margin: 15px 0 0;
	color: #535353;
}
.footer__emaillink,
.footer-tel__num {
	color: #535353;
}
.footer__emaillink:hover,
.footer-tel__num:hover {
	color: var(--main-color);
}
.footer-order__btn {
	display: inline-block;
	border-radius: 5px;
	background: var(--main-color);
	border: none;
	padding: 15px 35px;
	cursor: pointer;
	font-family: "MontserratSemiBold", sans-serif;
	color: #fff;
	font-size: 16px;
	line-height: 1;
	transition: all 0.4s ease 0s;
	cursor: pointer;
}
.footer-order__btn:hover {
	background: #002E74;
}
.footer .soc-nav__item {
	margin: 0 10px 0 0;
}
.footer .soc-nav__item:last-child {
	margin: 0;
}
.footer-bottom {
	margin: 30px 0 0;
}
.footer-bottom__plclink,
.footer-bottom__plctext {
	font-size: 16px;
	color: #535353;
}
.footer-bottom__plclink:hover {
	color: #002E74;
}


/*----------------------------------------------------------------
Modal
----------------------------------------------------------------*/

.scroll-disable {
	overflow: hidden;
}
.fancybox-bg {
	background: rgba(0,0,0,0.6);
}
.fancybox-close-small svg path {
	color: #000;
}
.modal {
	display: none;
	max-width: 450px;
	width: 100%;
}
.modal-callback,
.modal-cleaner {
	padding: 30px;
	background: #f2f2f2;
}
.modal-head {
	margin: 0 0 25px;
}
.modal-head--center {
	text-align: center;
}
.modal-head__title {
	font-family: "MontserratSemiBold", sans-serif;
    font-size: 24px;
	line-height: 1.1;
}
.modal-head__description {
	margin: 10px 0 0;
	color: #535353;
	font-size: 16px;
	line-height: 1.2;
}
.modal-form__group {
	margin: 0 0 15px 0;
}
.modal-form__group:last-child {
	margin: 30px 0 0;
	text-align: center;
}
.modal-form__policy a {
	color: #535353;
	text-decoration: underline;
}
.modal-form__policy a:hover {
	color: #002E74;
	text-decoration: none;
}
.modal-form__input {
	width: 100%;
	height: 40px;
	background: #fff;
	border: 1px solid #2b2a29;
	border-radius: 5px;
	padding: 0 15px;
	color: #2b2a29;
	font-size: 16px;
	line-height: 40px;
	text-align: left;
	-webkit-transition: all 0.4s ease 0s;
	-o-transition: all 0.4s ease 0s;
	transition: all 0.4s ease 0s;
}
.modal-form__input::-webkit-input-placeholder {
	color: #535353;
	opacity: 1;
}
.modal-form__input::-moz-placeholder {
	color: #535353;
	opacity: 1;
}
.modal-form__input:-ms-input-placeholder {
	color: #535353;
	opacity: 1;
}
.modal-form__input:-moz-placeholder {
	color: #535353;
	opacity: 1;
}
.modal-form__input:focus {
	border: 1px solid #323030;
}
.modal-form__input.error {
	border-color: red;
}
.modal-form__submit {
	display: block;
	width: 100%;
	margin: 0 auto;
	border: none;
	padding: 15px;
    border-radius: 5px;
    background: var(--main-color);
    font-family: "MontserratSemiBold", sans-serif;
    color: #fff;
    font-size: 18px;
    transition: all 0.4s ease 0s;
    cursor: pointer;
}
.modal-form__submit:hover {
	background: #002E74;
}
.modal-form__policy {
	margin: 25px 0 0;
	font-size: 14px;
	color: #535353;
}
.success-modal {
	padding: 40px 35px;
	background: #fff;
	text-align: center;
}
.success-modal__title {
	margin: 0 0 20px;
	font-family: "MontserratSemiBold", sans-serif;
	font-size: 24px;
}
.success-modal__description {
	font-size: 18px;
	line-height: 24px;
}


/*----------------------------------------------------------------
Adaptive styles
----------------------------------------------------------------*/

@media only screen and (max-width: 1440px) {

	.hero__bg {
		background-position: center center;
	}
	.hero__img {
		max-width: 600px;
	}

}


@media only screen and (max-width: 1360px) {

	.hero-edge {
		padding: 0 15px;
		height: 120px;
	}
	.hero-edge__title {
		font-size: 16px;
		line-height: 20px;
	}
	.hero-edge__ico {
		flex: 0 0 40px;
		max-width: 40px;
		max-height: 40px;
	}
	.navigation__link {
		padding: 14px;
		font-size: 16px;
	}

}


@media only screen and (max-width: 1280px) {

	.header__orderstime {
		flex: 0 0 150px;
		max-width: 150px;
	}
	.header__orderstime,
	.header__worktime {
		font-size: 14px;
	}
	.header__worktime {
		display: none;
	}
	.header-search {
		margin: 0;
		flex: 0 0 200px;
		max-width: 200px;
	}
	.hero__content {
		max-width: 500px;
	}
	.hero-edges__col {
		flex: 0 0 33.3333%;
		max-width: 33.3333%;
	}

}


@media only screen and (max-width: 1200px) {

	.header-nav > ul > li {
		margin: 0 10px;
	}
	.header-nav > ul > li > a {
		font-size: 13px;
	}
	.header-tel__callback {
		padding: 10px 15px;
		font-size: 14px;
	}	
	.hero__img {
		position: absolute;
		right: 0;
		max-width: 440px;
	}
	.chp .hero__img {
		max-width: 500px;
	}
	.hero-action {
		right: 30%;
	}
	.hero__title {
		font-size: 30px;
	}
	.hero__description,
	.hero__description p {
		font-size: 16px;
		line-height: 1.2;
	}
	.hero-buttons {
		margin: 30px 0 0;
	}
	.services-grid__col {
		flex: 0 0 33.3333%;
		max-width: 33.3333%;
	}
	.case-item__beforeafter {
		flex: 0 0 400px;
		max-width: 400px;
	}
	.casesb2b-top .case-item__beforeafter {
		flex: 0 0 640px;
		max-width: 640px;
	}
	.case-item__content {
		padding: 0 0 0 15px;
	}
	.case-item__stat {
		font-size: 14px;
	}
	.prices-grid__col {
		flex: 0 0 33.3333%;
		max-width: 33.3333%;
	}



	.calc-grid__col {
		flex: 0 0 20%;
		max-width: 20%;
	}


	.contacts-container__map {
		flex: 0 0 400px;
	}


	.footer-contacts {
		flex: 0 0 200px;
		max-width: 200px;
	}
	.footer-order__btn {
		padding: 15px 20px;
	}

}


@media only screen and (max-width: 1000px) {

	.layout {
		padding: 70px 0 0;
	}
	.header__orderstime,
	.header__worktime,
	.header__yawidget,
	.header-bottom,
	.header__soc {
		display: none;
	}
	.header-top {
		box-shadow: 6px 6px 12px rgba(0, 0, 0, 0.1);
	}
	.header__telbox {
		margin: 0 0 0 60px;
	}
	.header-search {
		margin: 0 30px 0 auto;
	}
	.menu-toggle-btn {
		display: flex;
	}
	.hero__inner {
		padding: 50px 0 0;
	}
	.hero__content {
		max-width: 400px;
	}
	.hero__title {
		font-size: 30px;
	}
	.hero__img {
		top: 50px;
		max-width: 450px;
	}
	.hero__container {
		margin: 0;
	}
	.chp .hero__img {
		width: 400px;
		height: 400px;
		max-width: 400px;
	}
	.hero-action {
		width: 180px;
		height: 180px;
		padding: 0 20px;
	}
	.hero-action__percent {
		margin: 5px 0 0;
		font-size: 30px;
	}
	.hero-action__bottomtext {
		margin: 5px 0 0;
	}
	.hero-edges {
		margin: 30px 0 0 0;
	}
	.hero-edges__col {
		flex: 0 0 50%;
		max-width: 50%;
	}
	.hero-edge {
		border: 1px solid #E5E5E5;
	}
	.includes-container__aside {
		flex: 0 0 150px;
		max-width: 150px;
	}
	.cta-container {
		padding: 15px;
	}
	.cta-container__content {
		flex: 0 0 220px;
		max-width: 220px;
	}
	.cta-container__button {
		flex: 0 0 260px;
		max-width: 260px;
	}
	.clients-slider-item__img {
		flex: 0 0 440px;
		max-width: 440px;
	}
	.letters-grid__col,
	.b-inventory-grid__col,
	.actions-grid__col,
	.videos-grid__col,
	.steps-grid__col {
		flex: 0 0 33.3333%;
		max-width: 33.3333%;
	}


	.calc-grid__col {
		flex: 0 0 25%;
		max-width: 25%;
	}
	.calc-grid-extended .calc-grid__col {
		flex: 0 0 33.3333%;
		max-width: 33.3333%;
	}
	.calc-resultbox {
		padding: 10px;
	}
	.calc-result-grid {
		padding: 5px 10px;
	}
	.calc-result-item {
		padding: 0 0 0 25px;
		font-size: 14px;
	}
	.calc-result-item:before {
		width: 20px;
    	height: 20px;
		background-size: 20px;
	}

	.b-includes-item-title__ico {
		display: none;
	}
	.b-includes-item-title__text {
		font-size: 13px;
	}



	.contacts-container {
		flex-wrap: wrap;
	}
	.contacts-container__map {
		order: 2;
		flex: 0 0 100%;
		max-width: none;
	}
	.contacts-container__side {
		margin: 0 0 30px;
		padding: 0;
	}
	

	.footer__row {
		flex-wrap: wrap;
	}
	.footer-logo {
		margin: 0 0 30px;
		flex: 0 0 100%;
		max-width: none;
		text-align: center;
	}
	.footer-navigates {
		padding: 0 15px 0 0;
	}
	.footer-contacts {
		flex: 0 0 220px;
		max-width: 220px;
	}

}


@media only screen and (max-width: 767px) {

	.header__telbox {
		margin: 0 0 0 15px;
	}
	.header-search {
		margin: 0 15px 0 auto;
		flex: 0 0 40px;
		max-width: 40px;
	}
	.header-search__ico {
		display: block;
	}
	.header-search-box {
		position: absolute;
		top: 0;
		right: 40px;
		z-index: -1;
		width: 250px;
		border-radius: 5px 0 0 5px;
		opacity: 0;
		visibility: hidden;
		background-color: #ccc;
	}
	.header-search-form__input {
		padding: 0 10px;
	}
	.hero {
		height: auto;
	}
	.hero__bg {
		height: 300px;
		position: static;
		background-position: right center;
	}
	.hero__title {
		font-size: 26px;
		line-height: 1.2;
	}
	.hero__description,
	.hero__description p {
		font-size: 16px;
		line-height: 1.2;		
	}
	.hero__inner {
		padding: 30px 0 60px;
		height: auto;
	}
	.hero__content,
	.hero-ctaform {
		max-width: none;
	}
	.hero__title {
		margin: 0 0 15px;
	}
	.hero__description {
		margin: 15px 0 0;
		font-size: 18px;
	}
	.hero-buttons {
		margin: 30px 0 0;
	}
	.hero-button {
		flex: 0 0 50%;
		max-width: 50%;
		font-size: 16px;
	}
	.hero__img {
		margin: 30px auto 0;
		width: 100%;
		max-width: 600px;
		position: relative;
		top: auto;
	}
	.hero__inner {
		padding: 0;
		margin: 30px 0 0 0;
	}
	.hero-action {
		top: -155px;
		right: 20%;
		width: 150px;
		height: 150px;
	}
	.hero-action__title,
	.hero-action__bottomtext {
		font-size: 10px;
	}
	.hero-action__percent {
		font-size: 40px;
	}
	.breadcrumbs-nav li,
	.breadcrumbs-nav a,
	.breadcrumbs-nav span {
		font-size: 14px;
		line-height: 16px;
	}
	.navigation ul {
		flex-wrap: wrap;
	}
	.navigation__item {
		margin: 5px 0;
	}
	.navigation__link {
		padding: 10px;
		font-size: 14px;
	}
	.table-box th,
	.table-box td {
		padding: 7px 5px;
		font-size: 14px;
		line-height: 1;
	}
	.cta-container {
		display: block;
		text-align: center;
	}
	.cta-container__content {
		margin: 0 auto 10px auto;
	}
	.cta-container .soc-nav ul {
		justify-content: center;
	}
	.cta-container__button {
		margin: 10px auto 0;
		display: inline-block;
		max-width: none;
		padding: 15px;
		font-size: 14px;
	}
	.prices-grid__col {
		flex: 0 0 50%;
		max-width: 50%;
	}
	.clients-slider-item__img {
		flex: 0 0 360px;
		max-width: 360px;
	}
	.clients-slider-item__title,
	.clients-slider-item-services {
		margin: 10px 0 0;
	}
	.clients-slider-item-services__title {
		margin: 0 0 5px;
		font-size: 16px;
	}
	.clients-slider-item__title {
		font-size: 16px;
	}
	.clients-slider-item-services__list li {
		font-size: 14px;
	}
	.includes-tabs {
		flex-wrap: wrap;
		margin: 0 0 10px;
	}
	.includes-tab {
		font-size: 14px;
		padding: 6px 8px;
	}
	.includes-container {
		display: block;
	}
	.includes-container__aside {
		display: flex;
		flex-wrap: wrap;
		max-width: none;
	}
	.includes-container__images {
		margin: 10px 0 0 0;
	}
	.b-includes-item-group--active {
		display: flex;
		flex-wrap: wrap;
		justify-content: center;
		width: 100%;
	}
	.b-includes-item-title,
	.b-includes-item-title:last-child {
		margin: 3px;
	}
	.b-includes-item-title {
		padding: 0;
		width: auto;
		min-height: 0;
		border-radius: 5px;
		font-size: 12px;
	}
	.b-includes-item-title__text {
		font-size: 12px;
		padding: 6px 8px;
		width: auto;
		min-height: 0;
		border-radius: 5px;
	}
	.b-includes-item__list {
		margin: 10px 0 0 0;
	}
	.b-includes-item__list li {
		font-size: 14px;
		padding: 0 0 0 8px;
	}
	.b-includes-item__list li:before {
		width: 4px;
		height: 4px;
	}
	.clients-slider,
	.cases-slider {
		padding: 0 40px;
	}
	.clients-slider .slick-arrow,
	.cases-slider .slick-arrow {
		width: 36px;
		height: 36px;
		background-size: 16px;
	}
	.case-item {
		display: block;
	}
	.case-item__title {
		margin: 0 0 10px;
		font-size: 18px;
	}
	.case-item__beforeafter {
		max-width: none;
	}
	.case-item__content {
		padding: 15px 0 0 0;
	}
	.case-item__bottom {
		margin: 10px 0 0;
		padding: 10px;
	}
	.casesb2b-items__col {
		flex: 0 0 33.3333%;
		max-width: 33.3333%;
	}
	.letters-grid__col,
	.b-inventory-grid__col,
	.actions-grid__col,
	.videos-grid__col,
	.steps-grid__col {
		flex: 0 0 50%;
		max-width: 50%;
	}
	.s-head {
		margin: 0 0 30px;
		padding: 0 0 15px 0;
	}
	.s-head__title,
	.page-title {
		font-size: 24px;
		line-height: 1.2;
	}
	.s-head__description {
		font-size: 14px;
		line-height: 1.2;
	}
	.entry-content h2,
	.entry-content h3,
	.entry-content h4,
	.entry-content h5 {
		margin: 40px 0 20px;
	}
	.entry-content h2:first-child,
	.entry-content h3:first-child,
	.entry-content h4:first-child,
	.entry-content h5:first-child {
		margin: 0 0 20px;
	}
	.entry-content h2 {
		font-size: 28px;
	}
	.entry-content h3 {
		font-size: 24px;
	}
	.entry-content h4 {
		font-size: 22px;
	}
	.entry-content h5 {
		font-size: 20px;
	}
	.entry-content p {	
		margin: 0 0 15px 0;
		font-size: 16px;
		line-height: 1.2;
	}
	.entry-content blockquote {
		margin: 15px 0;
		padding: 25px 15px;
	}
	.entry-content blockquote:before {
		content: none;
	}
	.entry-content blockquote p {
		margin: 0 0 15px 0;
		font-size: 16px;
		line-height: 1.2;
	}
	.entry-content ul,
	.entry-content ol {
		margin: 15px 0;
	}
	.entry-content ul li,
	.entry-content ol li {	
		margin: 0 0 5px 0;
		font-size: 16px;
		line-height: 1.2;
	}
	.entry-content ul li:before {
		top: 8px;
	}
	.entry-content ol li:before {
		top: 0;
		font-size: 16px;
		line-height: 1.2;
	}
	.actions-grid__title {
		font-size: 18px;
	}
	.inventories-tabs {
		margin: 0 0 15px;
		flex-wrap: wrap;
	}
	.inventory-tab {
		margin: 0 5px 5px 5px;
		padding: 10px;
		font-size: 14px;
	}
	.b-inventory-item__title {
		font-size: 16px;
	}
	.b-inventory-item__description {
		font-size: 14px;
	}
	.s-services {
		margin: 30px 0 15px;
	}
	.services-grid__col {
		flex: 0 0 50%;
		max-width: 50%;
	}
	.b-service-list li {
		padding: 0 0 0 15px;
		font-size: 14px;
	}
	.b-service-list li:before {
		width: 10px;
	}
	.b-service-item__title,
	.b-service-item__price {
		font-size: 16px;
	}
	.b-faq__title {
		font-size: 16px;
		line-height: 1.1;
	}
	.b-faq__text {
		font-size: 14px;
	}


	.calc-tabs__row {
		flex-wrap: wrap;
	}
	.calc-tabs__col {
		margin: 5px 0;
		flex: 0 0 50%;
		max-width: 50%;
	}
	.calc-grid__col,
	.calc-grid-extended .calc-grid__col {
		flex: 0 0 50%;
		max-width: 50%;
	}

	.calc-tab,
	.calc-grid-extended__title {
		font-size: 14px;
	}
	.calc-head {
		font-size: 14px;	
		min-height: 35px;
	}
	.calc-radio span,
	.calc-items--cleanobjtype-empty {
		font-size: 13px;
	}
	.calc-extended {
		padding: 15px 10px;
	}
	.calc-extended__title {
		font-size: 13px;
		min-height: 35px;
	}
	.calc-extended__ico {
		height: 40px;
	}
	.calc-resultbox__row {
		display: block;
	}
	.calc-resultbox__right {
		margin: 10px auto 0;
	}





	.footer-navigates {
		flex: 0 0 100%;
		padding: 0;
	}
	.footer-contacts {
		margin: 30px auto 0;
	}
	.footer__inner {
		display: block;
	}
	.footer-bottom__plctext {
		margin: 10px 0 0;
	}

}


@media only screen and (max-width: 640px) {

	.hero-edges__row {
		margin: 0 -5px;
	}
	.hero-edges__col {
		flex: 0 0 100%;
		max-width: none;
		margin: 10px 0 0;
		padding: 0 5px;
	}
	.hero-edge {
		padding: 0 15px;
		overflow: hidden;
	}
	.hero-edge__title {
		font-size: 14px;
		line-height: 1.1;
	}
	.hero-edge__description {
		font-size: 14px;
	}
	.clients-slider-item {
		display: block;
	}
	.clients-slider-item__img {
		max-width: none;
	}
	.clients-slider-item__content {
		padding: 10px 0 0 0;
	}
	.casesb2b-items__col {
		flex: 0 0 50%;
		max-width: 50%;
	}
	.mainform-box {
		display: block;
	}
	.mainform-box__img {
		text-align: center;
		max-width: none;
	}
	.mainform-box__right {
		margin: 30px 0 0;
		padding: 0;
	}

	.chp .hero__img {
		aspect-ratio: 1 / 1;
		width: 100%;
		height: auto;
	}
	.chp .hero-action {
		top: 0;
	}


	.calc-grid__fullcol {
		/* flex: 1; */
		flex-shrink: auto;
		flex-grow: 1;
	}



	.contacts-box__col {
		flex: 0 0 100%;
		max-width: none;
	}


}


@media only screen and (max-width: 480px) {
	
	.header__logo {
		flex: 0 0 80px;
		max-width: 80px;
	}
	.header__telbox {
		margin: 0 0 0 15px;
	}
	.header-telbox__title {
		display: none;
	}
	.header-search {
		margin: 0 5px 0 auto;
	}
	.header-search-box {
		width: 210px;
	}
	.hero__bg {
		background-position: 83% center;
	}
	.hero-cta {
		margin: 15px 0 0;
	}
	.hero-ctaform__row {
		display: block;
	}
	.hero-ctaform__col {
		margin: 0 0 10px;
		max-width: none;
	}
	.hero-ctaform__col:last-child {
		margin: 0;
		max-width: none;
	}
	.hero-buttons {
		display: block;
	}
	.hero-button {
		margin: 0 0 15px 0;
		width: 100%;
		max-width: none;
		border-radius: 10px;
	}
	.b2b .hero-button--white {
		margin: 0;
	}
	.b2b .hero-button--blue {
		margin: 0 0 15px 0;
	}
	.hero-button:last-child {
		margin: 0;
	}	
	.table-box th,
	.table-box td {
		font-size: 12px;
	}
	.prices-grid__col {
		flex: 0 0 100%;
		max-width: none;
	}
	.b-inventory-grid__col,
	.actions-grid__col,
	.services-grid__col,
	.videos-grid__col,
	.steps-grid__col {
		flex: 0 0 100%;
		max-width: none;
	}
	.b-service-item__title {
		min-height: 0;
	}

	.calc-result-item {
		padding: 0;
	}
	.calc-result-item:before {
		content: none;
	}
	.calc-resultbox__left {
		text-align: center;
	}
	.calc-resultbox__left .calc-result-reset {
		margin: 0 0 10px 0;
		display: inline-block;
	}
	.calc-resultbox__right .calc-result-reset {
		display: none;
	}
	.calc-result-grid {
		text-align: left;
	}



	.footer-navigates__heading,
	.footer-navigates__headinglink,
	.footer-nav li,
	.footer-nav a {
		font-size: 14px;
	}
	.modal-callback,
	.modal-cleaner {
		padding: 30px 15px;
	}
	.callback-form__rowl,
	.callback-form__policy {
		margin: 25px 0 0;
	}

}


@media only screen and (max-width: 375px) {

	.header__telbox {
		margin: 0 0 0 5px;
	}
	.header-telbox__number {
		font-size: 12px;
	}
	.table-box {
		overflow-x: scroll;
	}
	.table-box table {
		min-width: 360px;
	}

}